Aspyridone A

Catalog Number	ACM935863266
CAS Number	935863-26-6
IUPAC Name	3-[(2S,4S)-2,4-Dimethylhexanoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one
Molecular Weight	329.39
Molecular Formula	C19H23NO4
Canonical SMILES	CCC(C)CC(C)C(=O)C1=C(C(=CNC1=O)C2=CC=C(C=C2)O)O
InChI	InChI=1S/C19H23NO4/c1-4-11(2)9-12(3)17(22)16-18(23)15(10-20-19(16)24)13-5-7-14(21)8-6-13/h5-8,10-12,21H,4,9H2,1-3H3,(H2,20,23,24)/t11-,12-/m0/s1
InChI Key	LIBKJCZUBOETPB-RYUDHWBXSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	556
Exact Mass	329.16270821
Heavy Atom Count	24
Isomeric SMILES	CC[C@H](C)C[C@H](C)C(=O)C1=C(C(=CNC1=O)C2=CC=C(C=C2)O)O
Monoisotopic Mass	329.16270821
Topological Polar Surface Area	86.6Ų

Custom Q&A

What is the chemical formula for Aspyridone A?

The chemical formula for Aspyridone A is C19H23NO4.

What is the molar mass of Aspyridone A?

The molar mass of Aspyridone A is 329.39 g/mol.

What is the predicted boiling point of Aspyridone A?

The predicted boiling point of Aspyridone A is 532.8±50.0 °C.

What is the predicted density of Aspyridone A?

The predicted density of Aspyridone A is 1.219±0.06 g/cm3.

What is the pKa value of Aspyridone A?

The pKa value of Aspyridone A is 4.50±1.00.

Is Aspyridone A a common name for this compound?

Yes, Aspyridone A is a common name for this compound.

What is the molecular formula of Aspyridone A?

The molecular formula of Aspyridone A is C19H23NO4.

What is the predicted boiling point range of Aspyridone A?

The predicted boiling point range of Aspyridone A is 532.8±50.0 °C.

What is the predicted density range of Aspyridone A?

The predicted density range of Aspyridone A is 1.219±0.06 g/cm3.

※ Please kindly note that our products are for research use only.