Atalafoline

Atalafoline

Inquiry
Catalog Number ACM107259494
CAS Number 107259-49-4
Structure
Synonyms 1,3-Dihydroxy-2,5,6-trimethoxy-10-methylacridin-9-one
Molecular Weight 331.32
InChI InChI=1S/C17H17NO6/c1-18-9-7-10(19)16(23-3)15(21)12(9)14(20)8-5-6-11(22-2)17(24-4)13(8)18/h5-7,19,21H,1-4H3
InChI Key SMZNQRJKSRSJJH-UHFFFAOYSA-N
Melting Point 155-158 °C
Purity 95%+
Complexity 474
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 331.10558726
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 2
Monoisotopic Mass 331.10558726
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 88.5 Ų
Custom Q&A

What is the chemical name of atalafoline?

Atalafoline is also known as 1,3-dihydroxy-2,5,6-trimethoxy-10-methylacridin-9-one.

What is the CAS number for atalafoline?

The CAS number for atalafoline is 107259-49-4.

What is the molecular formula of atalafoline?

The molecular formula of atalafoline is C17H17NO6.

What is the molecular weight of atalafoline?

The molecular weight of atalafoline is 331.32.

What is the melting point of atalafoline?

The melting point of atalafoline is 155-158 °C when dissolved in acetone.

What is the predicted boiling point of atalafoline?

The predicted boiling point of atalafoline is 593.4±50.0 °C.

What is the predicted density of atalafoline?

The predicted density of atalafoline is 1.366±0.06 g/cm3.

What is the predicted pka value of atalafoline?

The predicted pka value of atalafoline is 6.89±0.20.

How many oxygen atoms are present in the chemical formula of atalafoline?

There are six oxygen atoms present in the chemical formula of atalafoline.

How many carbon atoms are present in the chemical formula of atalafoline?

There are seventeen carbon atoms present in the chemical formula of atalafoline.

※ Please kindly note that our products are for research use only.