Atalaphylline

Atalaphylline

Inquiry
Catalog Number ACM28233343
CAS Number 28233-34-3 / 28233-35-4
Synonyms 1,3,5-Trihydroxy-2,4-bis(3-methyl-2-butenyl)-9(10H)-acridinone
Molecular Weight 379.4
InChI InChI=1S/C23H25NO4/c1-12(2)8-10-15-20-18(23(28)16(21(15)26)11-9-13(3)4)22(27)14-6-5-7-17(25)19(14)24-20/h5-9,25-26,28H,10-11H2,1-4H3,(H,24,27)
InChI Key GLXYKTASIIUSRC-UHFFFAOYSA-N
Purity 95%+
Complexity 635
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 379.17835828
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 4
Monoisotopic Mass 379.17835828
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 89.8 Ų
Custom Q&A

What is the chemical formula for Atalaphylline?

The chemical formula for Atalaphylline is C23H25NO4.

What is the molar mass of Atalaphylline?

The molar mass of Atalaphylline is 379.45 g/mol.

What is the melting point of Atalaphylline?

The melting point of Atalaphylline is 243-245 °C.

What is the predicted boiling point of Atalaphylline?

The predicted boiling point of Atalaphylline is 584.9±50.0 °C.

What is the predicted density of Atalaphylline?

The predicted density of Atalaphylline is 1.242±0.06 g/cm3.

What is the predicted pka value of Atalaphylline?

The predicted pka value of Atalaphylline is 7.93±0.20.

How is Atalaphylline defined in ChEBI?

Atalaphylline is defined in ChEBI as a member of acridines functionally related to an acridone.

What are the synonyms of Atalaphylline?

The synonyms of Atalaphylline are 9(10H)-Acridinone and 1,3,5-trihydroxy-2,4-bis(3-methyl-2-buten-1-yl)-.

What is the CAS number for Atalaphylline?

The CAS number for Atalaphylline is 28233-35-4.

※ Please kindly note that our products are for research use only.