Atanine

Catalog Number	ACM7282191
CAS Number	7282-19-1
Molecular Weight	243.3
InChI	InChI=1S/C15H17NO2/c1-10(2)8-9-12-14(18-3)11-6-4-5-7-13(11)16-15(12)17/h4-8H,9H2,1-3H3,(H,16,17)
InChI Key	SPIWINZXMDJUPE-UHFFFAOYSA-N
Purity	95%+
Complexity	391
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	243.125928785
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Monoisotopic Mass	243.125928785
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	38.3 Ų

Custom Q&A

What is the chemical formula of atanine?

The chemical formula of atanine is C15H17NO2.

What is the molecular weight of atanine?

The molecular weight of atanine is 243.3.

What is the melting point of atanine?

The melting point of atanine is 133 °C.

In what solvents is atanine soluble?

atanine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does atanine come in?

atanine comes in the form of a powder.

What is the pka of atanine?

The pka of atanine is 10.86±0.70 (Predicted).

What are the properties of atanine that make it useful as an anthelmintic and antiparasitic agent?

atanine possesses anthelmintic and antiparasitic activities.

What is the predicted boiling point of atanine?

The predicted boiling point of atanine is 433.9±45.0 °C.

What is the CAS number of atanine?

The CAS number of atanine is 7282-19-1.

What is the target of atanine in terms of its activity?

The target of atanine is antifection.

※ Please kindly note that our products are for research use only.