Axillaridine

Catalog Number	ACM23506969
CAS Number	23506-96-9
Structure
Synonyms	12-Ethyl-14,19-dihydro-12ξ,13ξ-dihydroxy-19-methyl-17,18-dinorcrotalanan-11,15-dione
Molecular Weight	353.4
InChI	InChI=1S/C18H27NO6/c1-4-18(23)15(20)13(10(2)3)16(21)25-12-6-8-19-7-5-11(14(12)19)9-24-17(18)22/h5,10,12-15,20,23H,4,6-9H2,1-3H3/t12-,13-,14-,15-,18-/m1/s1
InChI Key	PHBXHCOARFTKGZ-VFCJXBEMSA-N
Melting Point	148-152 °C
Purity	95%+
Complexity	588
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	353.18383758
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@]1([C@@H]([C@H](C(=O)O[C@@H]2CCN3[C@@H]2C(=CC3)COC1=O)C(C)C)O)O
Monoisotopic Mass	353.18383758
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the chemical name of the compound Axillaridine?

The chemical name of Axillaridine is 12-Ethyl-14,19-dihydro-12ξ,13ξ-dihydroxy-19-methyl-17,18-dinorcrotalanan-11,15-dione.

What are the synonyms for Axillaridine?

The synonyms for Axillaridine are 2H-[1,6]Dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione, 5-ethyl-4,5,8,10,12,13,13a,13b-octahydro-4,5-dihydroxy-3-(1-methylethyl)-, (3R,4R,5R,13aR,13bR).

What is the CAS number of Axillaridine?

The CAS number of Axillaridine is 23506-96-9.

What is the molecular formula of Axillaridine?

The molecular formula of Axillaridine is C18H27NO6.

What is the molecular weight of Axillaridine?

The molecular weight of Axillaridine is 353.41.

What is the melting point of Axillaridine?

The melting point of Axillaridine is 148-152 °C.

What is the predicted boiling point of Axillaridine?

The predicted boiling point of Axillaridine is 559.1±50.0 °C.

What is the predicted density of Axillaridine?

The predicted density of Axillaridine is 1.29±0.1 g/cm3.

What is the predicted pKa value of Axillaridine?

The predicted pKa value of Axillaridine is 12.17±0.60.

※ Please kindly note that our products are for research use only.