Baptifoline

Catalog Number	ACM732503
CAS Number	732-50-3
Synonyms	(7R)-7,7aα,8,9,10,11,13,14-Octahydro-9β-hydroxy-7β,14β-methano-4H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocin-4-one
Molecular Weight	260.33
InChI	InChI=1S/C15H20N2O2/c18-12-4-5-16-8-10-6-11(14(16)7-12)9-17-13(10)2-1-3-15(17)19/h1-3,10-12,14,18H,4-9H2/t10-,11-,12+,14-/m1/s1
InChI Key	AOOCSKCGZYCEJX-NRWUCQMLSA-N
Purity	95%+
Complexity	471
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	260.152477885
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1CN2C[C@H]3C[C@@H]([C@H]2C[C@H]1O)CN4C3=CC=CC4=O
Monoisotopic Mass	260.152477885
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	43.8 Ų

Custom Q&A

What is the chemical name of baptifoline?

(7R)-7,7aα,8,9,10,11,13,14-Octahydro-9β-hydroxy-7β,14β-methano-4H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocin-4-one

What is the molecular formula of baptifoline?

C15H20N2O2

What is the molecular weight of baptifoline?

260.33

What is the CAS number of baptifoline?

732-50-3

What are the synonyms of baptifoline?

baptifoline, 7,14-Methano-2H,11H-dipyrido[1,2-a:1',2'-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-2-hydroxy-, (2R,7R,14R,14aR)-

How many nitrogen atoms are present in the molecular structure of baptifoline?

Two nitrogen atoms

What is the stereochemistry of the baptifoline molecule?

The stereochemistry is shown as (2R,7R,14R,14aR)

※ Please kindly note that our products are for research use only.