Barasertib (AZD1152-HQPA)

Catalog Number	ACM722544516
CAS Number	722544-51-6
Synonyms	Barasertib-hQPA
IUPAC Name	2-[3-[[7-[3-[Ethyl(2-hydroxyethyl)amino]propoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]-N-(3-fluorophenyl)acetamide
Molecular Weight	507.56
Molecular Formula	C26H30FN7O3
Canonical SMILES	CCN(CCCOC1=CC2=C(C=C1)C(=NC=N2)NC3=NNC(=C3)CC(=O)NC4=CC(=CC=C4)F)CCO
InChI	InChI=1S/C26H30FN7O3/c1-2-34(10-11-35)9-4-12-37-21-7-8-22-23(16-21)28-17-29-26(22)31-24-14-20(32-33-24)15-25(36)30-19-6-3-5-18(27)13-19/h3,5-8,13-14,16-17,35H,2,4,9-12,15H2,1H3,(H,30,36)(H2,28,29,31,32,33)
InChI Key	QYZOGCMHVIGURT-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	693
Exact Mass	507.23941601
Heavy Atom Count	37
Monoisotopic Mass	507.23941601
Topological Polar Surface Area	128Ų

Custom Q&A

What is the chemical formula of Barasertib (AZD1152-HQPA)?

The chemical formula of Barasertib (AZD1152-HQPA) is C26H30FN7O3.

What is the boiling point of Barasertib (AZD1152-HQPA)?

The boiling point of Barasertib (AZD1152-HQPA) is predicted to be 796.7±60.0 °C.

What is the storage temperature recommended for Barasertib (AZD1152-HQPA)?

The recommended storage temperature for Barasertib (AZD1152-HQPA) is 2-8°C.

What is the solubility of Barasertib (AZD1152-HQPA) in DMSO?

Barasertib (AZD1152-HQPA) is soluble in DMSO at >15 mg/mL.

What is the color of Barasertib (AZD1152-HQPA)?

Barasertib (AZD1152-HQPA) is white to beige in color.

What is the role of AZD1152-HQPA?

AZD1152-HQPA is a potent and highly selective inhibitor of Aurora B kinase.

How does AZD1152-HQPA affect the growth of tumors in cancer models?

AZD1152-HQPA inhibits the growth of tumors in multiple cancer models.

What have been proposed as novel mechanisms of cytotoxicity of AZD1152-HQPA?

Excessive ROS generation and upregulated tumor suppressor miRNAs have been proposed as novel mechanisms of cytotoxicity of AZD1152-HQPA.

How is AZD1152-HQPA used in studying the relevance of AURKB as a cancer therapeutic target?

AZD1152-HQPA has been used as a component to study the relevance of AURKB as a cancer therapeutic target.

What is the target of Barasertib (AZD1152-HQPA)?

The target of Barasertib (AZD1152-HQPA) is Aurora B kinase.

※ Please kindly note that our products are for research use only.