Benzoyltropein

Catalog Number	ACM19145609
CAS Number	19145-60-9
Molecular Weight	245.32
InChI	InChI=1S/C15H19NO2/c1-16-12-7-8-13(16)10-14(9-12)18-15(17)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3
InChI Key	XQJMXPAEFMWDOZ-UHFFFAOYSA-N
Melting Point	41.5 °C
Purity	95%+
Complexity	298
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	245.141578849
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	245.141578849
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical formula for Benzoyltropein?

The chemical formula for Benzoyltropein is C15H19NO2.

What is the CAS number for Benzoyltropein?

The CAS number for Benzoyltropein is 19145-60-9.

What is the molecular weight of Benzoyltropein?

The molecular weight of Benzoyltropein is 245.32 g/mol.

What is the melting point of Benzoyltropein?

The melting point of Benzoyltropein is 41.5°C.

What is the boiling point of Benzoyltropein?

The boiling point of Benzoyltropein is approximately 388.28°C.

What is the density of Benzoyltropein?

The density of Benzoyltropein is approximately 1.0479.

What is the refractive index of Benzoyltropein?

The refractive index of Benzoyltropein is estimated to be 1.5200.

What is the pka value of Benzoyltropein?

The pka value of Benzoyltropein is predicted to be 10.20±0.40.

What is the definition of Benzoyltropein according to ChEBI?

Tropacocaine is a benzoate ester.

What is the chemical structure of Benzoyltropein?

The chemical structure of Benzoyltropein is a benzoate ester of 8-methyl-8-azabicyclo[3.2.1]octan-3-ol.

※ Please kindly note that our products are for research use only.