Berberine chloride

Berberine chloride

Inquiry
Catalog Number ACM633658-2
CAS Number 633-65-8
Structure
Description Activates AMPK enzyme; anti-inflammatory; anti-diabetic
Synonyms 5,6-Dihydro-9,10-dimethoxybenzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium chlorideBerberine hydrochloride7,8,13,13a-Tetradehydro-9,1 0-dimethoxy-2,3-(methylenedioxy)berbinium chloride
Molecular Weight 371.81 g/mol
Molecular Formula C20H18ClNO4
Canonical SMILES COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-]
InChI InChI=1S/C20H18NO4.ClH/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1
InChI Key VKJGBAJNNALVAV-UHFFFAOYSA-M
Melting Point 204-206 °C
Purity 95%+
Appearance Solid
Storage store at 2℃-8℃
Complexity 488
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 371.0924357
Harmonized Tariff Code Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939490000 - China: 2939799091
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
MDL Number MFCD00011939
Monoisotopic Mass 371.0924357
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the chemical formula of Berberine chloride?

The chemical formula of Berberine chloride is C20H20ClNO5.

What is the molecular weight of Berberine chloride?

The molecular weight of Berberine chloride is 389.83.

How does Berberine chloride appear in terms of color and form?

Berberine chloride appears as a pale yellow to yellow solid.

What is the water solubility of Berberine chloride?

Berberine chloride is soluble in water.

What are the safety hazard codes for Berberine chloride?

The safety hazard code for Berberine chloride is Xn.

What is the primary use of Berberine chloride?

Berberine chloride is primarily used for the treatment of gastroenteritis, dysentery, other intestinal infections, conjunctivitis, and purulent otitis media.

What are some examples of salts that can be derived from Berberine chloride?

Crystal_line salts such as nitrate, sulphate, and picrate can be derived from Berberine chloride.

What is the melting point range of Berberine chloride?

The melting point range of Berberine chloride is 204-206 °C (dec.).

What is the storage recommendation for Berberine chloride?

Berberine chloride should be sealed in dry conditions at room temperature.

How does Berberine chloride respond to oxidation with KMnO4 in Me2CO?

Berberine chloride oxidizes with KMnO4 in Me2CO to give hemipinic acid.

※ Please kindly note that our products are for research use only.