Berberine hydrogen sulphate

Catalog Number	ACM633669
CAS Number	633-66-9
Structure
Description	Berberine is a natural compound that has been shown to have anti-inflammatory and anticancer properties. It is the main component of berberine sulfate, which can be found in plants such as Coptis chinensis and goldenseal. Berberine sulfate has been shown to inhibit skin tumor formation by inhibiting nuclear DNA synthesis and tumor cell growth. Berberine sulfate also inhibits the production of p-nitrophenyl phosphate, a chemical that is used as an indicator for bacterial growth. Berberine sulfate binds to DNA polymerase and inhibits its activity, thereby preventing transcription of DNA into RNA. This compound can be used in chromatographic analysis and optical sensor systems to detect bacterial infections.
Synonyms	Natural Yellow 18
Molecular Weight	433.43 g/mol
Molecular Formula	C20H18NO4·HSO4
Canonical SMILES	COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.OS(=O)(=O)[O-]
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939490000 - China: 2939799099
MDL Number	MFCD00075789

Custom Q&A

What is the chemical name of the compound berberine acid sulfate?

The chemical name of the compound berberine acid sulfate is berberine hydrogen sulphate.

What is the CAS number for berberine acid sulfate?

The CAS number for berberine acid sulfate is 633-66-9.

What are some synonyms for berberine acid sulfate?

Some synonyms for berberine acid sulfate are Berbamine sulphate acid, berberine sulfate, and siarczan uberberyny.

What is the molecular formula of berberine acid sulfate?

The molecular formula of berberine acid sulfate is C20H19NO8S.

What is the melting point of berberine acid sulfate?

The melting point of berberine acid sulfate is 274-275 °C (decomp).

In what forms is berberine acid sulfate soluble?

Berberine acid sulfate is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What are the safety hazard codes associated with berberine acid sulfate?

The safety hazard codes associated with berberine acid sulfate are Xn.

What are some common uses of berberine acid sulfate?

Berberine acid sulfate is used as an isoquinoline alkaloid with chemopreventative properties. It is also used in the preparation of derivatives showing activity against leishmaniasis and malaria.

How should berberine acid sulfate be stored?

Berberine acid sulfate should be stored in an inert atmosphere at room temperature.

What is the molecular weight of berberine acid sulfate?

The molecular weight of berberine acid sulfate is 433.43.

※ Please kindly note that our products are for research use only.