Betonicine

Betonicine

Inquiry
Catalog Number ACM515253
CAS Number 515-25-3
Structure
Synonyms 4-Hydroxy-1,1-dimethylpyrrolidinium-2-carboxylate
Molecular Weight 159.18
Molecular Formula C7H13NO3
InChI InChI=1S/C7H13NO3/c1-8(2)4-5(9)3-6(8)7(10)11/h5-6,9H,3-4H2,1-2H3/t5-,6+/m1/s1
InChI Key MUNWAHDYFVYIKH-RITPCOANSA-N
Melting Point 246-248 °C
Purity 95%+
Appearance Off-white Powder
Complexity 173
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 2
Exact Mass 159.08954328
Heavy Atom Count 11
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Isomeric SMILES C[N+]1(C[C@@H](C[C@H]1C(=O)[O-])O)C
Monoisotopic Mass 159.08954328
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 60.4 Ų
Custom Q&A

What is the chemical formula for Betonicine?

The chemical formula for Betonicine is C7H13NO3.

What is the molecular weight of Betonicine?

The molecular weight of Betonicine is 159.18.

What is the CAS number of Betonicine?

The CAS number of Betonicine is 515-25-3.

What are some synonyms for Betonicine?

Some synonyms for Betonicine include trans-2-Carboxy-4-hydroxy-1,1-dimethylpyrrolidinium hydroxide and 4-Hydroxy-stachydrine.

What is the melting point of Betonicine?

The melting point of Betonicine is 246-248°C.

What is the boiling point of Betonicine?

The boiling point of Betonicine is approximately 284.67°C.

What is the safety information for Betonicine?

The safety statements for Betonicine are 22-24/25 and it has a WGK Germany rating of 3.

How is Betonicine defined in ChEBI?

Betonicine is defined in ChEBI as an amino-acid betaine that is a trans-4-hydroxy-L-proline zwitterion in which both of the hydrogens attached to the nitrogen have been replaced by methyl groups.

What is the density of Betonicine?

The density of Betonicine is approximately 1.2013.

What is the LogP value of Betonicine?

The LogP value of Betonicine is -4.240.

※ Please kindly note that our products are for research use only.