Bianfugenine

Bianfugenine

Inquiry
Catalog Number ACM88142603
CAS Number 88142-60-3
Synonyms Dauriporphine
Molecular Weight 351.4
InChI InChI=1S/C20H17NO5/c1-23-10-5-6-11-13(9-10)17(22)15-14-12(7-8-21-16(11)14)18(24-2)20(26-4)19(15)25-3/h5-9H,1-4H3
InChI Key OOWSNEKQIRVGCG-UHFFFAOYSA-N
Purity 95%+
Complexity 528
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 351.11067264
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 351.11067264
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 66.9 Ų
Custom Q&A

What is the chemical formula of bianfugenine?

The chemical formula of bianfugenine is C20H17NO5.

What is the molecular weight of bianfugenine?

The molecular weight of bianfugenine is 351.35.

What is another name for bianfugenine?

Another name for bianfugenine is Dauriporphine.

What is the role of bianfugenine as?

Bianfugenine has a role as a plant metabolite, a platelet aggregation inhibitor, and an antineoplastic agent.

What type of compound is bianfugenine classified as?

Bianfugenine is classified as an isoquinoline alkaloid, a polyether, an aromatic ether, a cyclic ketone, an aromatic ketone, and an organic heterotetracyclic compound.

How many methoxy substituents does bianfugenine have?

Bianfugenine carries four methoxy substituents at positions 4, 5, 6, and 9.

What is the chemical structure of bianfugenine?

The chemical structure of bianfugenine is that of dibenzo[de,h]quinolin-7-one.

What is the CAS number for bianfugenine?

The CAS number for bianfugenine is 88142-60-3.

What is the primary source of bianfugenine?

Bianfugenine is primarily obtained from plants as a plant metabolite.

How does bianfugenine function as an antineoplastic agent?

As an antineoplastic agent, bianfugenine is able to inhibit the growth of cancer cells.

※ Please kindly note that our products are for research use only.