Bicuculline

Catalog Number	ACM485494-1
CAS Number	485-49-4
Structure
Synonyms	6-[(5S)-5,6,7,8-Tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]-(6R)-furo[3,4-e]-1,3-benzodioxol-8(6H)-one
Molecular Weight	367.4
InChI	InChI=1S/C20H17NO6/c1-21-5-4-10-6-14-15(25-8-24-14)7-12(10)17(21)18-11-2-3-13-19(26-9-23-13)16(11)20(22)27-18/h2-3,6-7,17-18H,4-5,8-9H2,1H3/t17-,18+/m0/s1
InChI Key	IYGYMKDQCDOMRE-ZWKOTPCHSA-N
Melting Point	193-197 °C
Purity	98%+
Complexity	615
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	367.10558726
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3
Monoisotopic Mass	367.10558726
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the chemical formula of (+)-Bicuculline?

The chemical formula of (+)-Bicuculline is C20H17NO6.

What is the melting point of (+)-Bicuculline?

The melting point of (+)-Bicuculline is 193-197 °C.

What is the solubility of (+)-Bicuculline?

(+)-Bicuculline is soluble in Benzene, Chloroform, DMSO, and Ethyl Acetate.

What is the optical activity of (+)-Bicuculline in CHCl3?

The optical activity of (+)-Bicuculline in CHCl3 is alpha D25 +130.5°.

What is the boiling point of (+)-Bicuculline?

The boiling point of (+)-Bicuculline is around 497.92°C.

What is the Hazard Class of (+)-Bicuculline?

The Hazard Class of (+)-Bicuculline is 6.1(b).

What is the primary usage of (+)-Bicuculline?

The primary usage of (+)-Bicuculline is as a GABAA receptor antagonist.

What is the safety profile of (+)-Bicuculline?

(+)-Bicuculline is considered a poison by intraperitoneal route and emits toxic vapors when heated to decomposition.

How does (+)-Bicuculline act in terms of GABAA receptors?

(+)-Bicuculline acts as a competitive inhibitor of GABA ligand binding to the receptor.

What is the purification method for (+)-Bicuculline?

(+)-Bicuculline can be purified by crystallization from CHCl3/MeOH, with a melting point range of 193-195°C.

※ Please kindly note that our products are for research use only.