(+)-Bicuculline

Catalog Number	ACM485494-2
CAS Number	485-49-4
Description	Inhibitor of ionotropic receptor GABA(A)
Synonyms	(6R)-6-[(5S)-5,6,7,8-Tetrahydro-6-methyl-1,3-dioxolo[4,5-g]lisoquinolin-5-yl]furo[3,4-e]-1,3-benzodioxol-8(6H)-oneBicucullineD-Bic uculline
Molecular Weight	367.35 g/mol
Molecular Formula	C20H17NO6
Canonical SMILES	CN1CCC2=CC3=C(C=C2[C@H]1[C@H]4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939791000 - UK: 2939790000 - China: 2939799091
MDL Number	MFCD00005006

Custom Q&A

What is the synonym for (+)-Bicuculline?

Bicucullin, Bucuculline, D-Bicuculline, D-alkali than buttoned Spirit

What is the chemical formula for (+)-Bicuculline?

C20H17NO6

What is the melting point of (+)-Bicuculline?

193-197 °C

What is the optical activity of (+)-Bicuculline in chloroform?

[α]20/D +126±6°, c = 1% in chloroform

What are the safety hazard codes associated with (+)-Bicuculline?

T, N, Xn

What is the main usage of (+)-Bicuculline?

GABAA receptor antagonist

What plant was (+)-Bicuculline originally isolated from?

Dicentra cucullaria

What biological activity does (+)-Bicuculline exhibit?

Classical GABA A antagonist

How does (+)-Bicuculline act at the receptor level?

As a competitive inhibitor of GABA ligand binding to the receptor

What is the storage temperature recommended for (+)-Bicuculline?

+4°C

※ Please kindly note that our products are for research use only.