Birabresib

Catalog Number	ACM202590985
CAS Number	202590-98-5
IUPAC Name	2-[(9S)-7-(4-Chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]-N-(4-hydroxyphenyl)acetamide
Molecular Weight	491.99
Molecular Formula	C25H22ClN5O2S
Canonical SMILES	CC1=C(SC2=C1C(=NC(C3=NN=C(N32)C)CC(=O)NC4=CC=C(C=C4)O)C5=CC=C(C=C5)Cl)C
InChI	InChI=1S/C25H22ClN5O2S/c1-13-14(2)34-25-22(13)23(16-4-6-17(26)7-5-16)28-20(24-30-29-15(3)31(24)25)12-21(33)27-18-8-10-19(32)11-9-18/h4-11,20,32H,12H2,1-3H3,(H,27,33)/t20-/m0/s1
InChI Key	GNMUEVRJHCWKTO-FQEVSTJZSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	770
Exact Mass	491.1182738
Heavy Atom Count	34
Isomeric SMILES	CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)NC4=CC=C(C=C4)O)C5=CC=C(C=C5)Cl)C
Monoisotopic Mass	491.1182738
Topological Polar Surface Area	121Ų

Custom Q&A

What is the chemical formula of OTX015?

The chemical formula of OTX015 is C25H22ClN5O2S.

What is the melting point of OTX015?

The melting point of OTX015 is 220 °C.

What is the solubility of OTX015 in DMSO?

The solubility of OTX015 in DMSO is ≥24.6 mg/mL.

What is the primary function of OTX015?

OTX015 is a potent BET bromodomain inhibitor.

What is the target of OTX015 in the body?

The target of OTX015 is BRD2.

What are the safety features of OTX015?

The HS code for OTX015 is 2934.99.3900.

How does OTX015 inhibit the growth of cancer cells in vitro?

OTX015 inhibits the binding of BRD2, BRD3, and BRD4 to AcH4, resulting in growth inhibition.

What is the impact of OTX015 on c-MYC expression?

OTX015 results in rapid down-regulation of c-MYC expression.

What is the bioavailability of OTX015?

OTX015 is orally bioavailable.

How does OTX015 affect the growth of Ty82 BRD-NUT midline carcinoma tumors in nude mice?

OTX015 significantly inhibits the growth of Ty82 BRD-NUT midline carcinoma tumors in nude mice.

※ Please kindly note that our products are for research use only.