Bisdehydroneotuberostemonine

Bisdehydroneotuberostemonine

Inquiry
Catalog Number ACM160333277
CAS Number 160333-27-7
Synonyms [2(2S,4S),10alpha,11alpha]-1,2,12,13-Tetradehydro-2-(tetrahydro-4-methyl-5-oxo-2-furanyl)stenine
Molecular Weight 371.5
InChI InChI=1S/C22H29NO4/c1-4-13-14-7-5-6-8-23-16(17-9-11(2)21(24)26-17)10-15(19(14)23)18-12(3)22(25)27-20(13)18/h10-14,17-18,20H,4-9H2,1-3H3
InChI Key RFGMIDHPFYCJDM-UHFFFAOYSA-N
Purity 95%+
Complexity 636
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 371.20965841
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 371.20965841
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 57.5 Ų
Custom Q&A

What is the chemical formula for Bisdehydroneotuberostemonine?

The chemical formula for Bisdehydroneotuberostemonine is C22H29NO4.

What is the molecular weight of Bisdehydroneotuberostemonine?

The molecular weight of Bisdehydroneotuberostemonine is 371.47.

What is the boiling point of Bisdehydroneotuberostemonine?

The predicted boiling point of Bisdehydroneotuberostemonine is 600.3±55.0 °C.

What is the density of Bisdehydroneotuberostemonine?

The predicted density of Bisdehydroneotuberostemonine is 1.43±0.1 g/cm3.

What is the predicted pka value of Bisdehydroneotuberostemonine?

The predicted pka value of Bisdehydroneotuberostemonine is -3.86±0.60.

What are some synonyms for Bisdehydroneotuberostemonine?

Some synonyms for Bisdehydroneotuberostemonine include [2(2S,4S),10alpha,11alpha]-1,2,12,13-Tetradehydro-2-(tetrahydro-4-methyl-5-oxo-2-furanyl)stenine and Furo[2,3-h]pyrrolo[3,2,1-jk][1]benzazepin-10(4H)-one, 8-ethyl-5,6,7,7a,8,8a,11,11a-octahydro-11-methyl-2-[(2S,4S)-tetrahydro-4-methyl-5-oxo-2-furanyl]-, (7aR,8R,8aR,11S,11aS)-.

What is the CAS number for Bisdehydroneotuberostemonine?

The CAS number for Bisdehydroneotuberostemonine is 160333-27-7.

What is the stereochemistry of Bisdehydroneotuberostemonine?

The stereochemistry of Bisdehydroneotuberostemonine is (7aR,8R,8aR,11S,11aS).

What is the functional group present in Bisdehydroneotuberostemonine?

Bisdehydroneotuberostemonine contains functional groups such as furanyl, tetrahydro, and benzazepin.

※ Please kindly note that our products are for research use only.