Bisline

Bisline

Inquiry
Catalog Number ACM30258287
CAS Number 30258-28-7
Synonyms Deacetylisoline
Molecular Weight 353.4
InChI InChI=1S/C18H27NO6/c1-4-18(23)9-11(2)17(3,22)15(20)24-10-12-5-7-19-8-6-13(14(12)19)25-16(18)21/h5,11,13-14,22-23H,4,6-10H2,1-3H3/t11-,13-,14-,17+,18-/m1/s1
InChI Key QZJRTVIGIAAJPX-GPBKISAOSA-N
Melting Point 169 °C
Purity 95%+
Complexity 604
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 5
Exact Mass 353.18383758
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 2
Isomeric SMILES CCC1(CC(C(C(=O)OCC2=CCN3C2C(CC3)OC1=O)(C)O)C)O
Monoisotopic Mass 353.18383758
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 96.3 Ų
Custom Q&A

What is the chemical formula of Bisline?

The chemical formula of Bisline is C18H27NO6.

What is the molecular weight of Bisline?

The molecular weight of Bisline is 353.41 g/mol.

What is the CAS number of Bisline?

The CAS number of Bisline is 30258-28-7.

What is the predicted boiling point of Bisline?

The predicted boiling point of Bisline is 570.2±50.0 °C.

What is the predicted density of Bisline?

The predicted density of Bisline is 1.30±0.1 g/cm3.

What is the predicted pKa value of Bisline?

The predicted pKa value of Bisline is 12.74±0.60.

How does the melting point of Bisline compare to standard atmospheric conditions?

The melting point of Bisline is 169 °C, which is above standard room temperature conditions.

What are some synonyms for Bisline?

Some synonyms for Bisline include deacetylisoline; [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethyl-3,4,5,6,9,11,13,14,14a,14b-decahydro-3,6-dihydroxy-5,6-dimethyl-, (3R,5R,6S,14aR,14bR)-

※ Please kindly note that our products are for research use only.