Bocconoline

Bocconoline

Inquiry
Catalog Number ACM32906880
CAS Number 32906-88-0
Structure
Molecular Weight 379.4
InChI InChI=1S/C22H21NO5/c1-23-16(10-24)20-13(6-7-17(25-2)22(20)26-3)14-5-4-12-8-18-19(28-11-27-18)9-15(12)21(14)23/h4-9,16,24H,10-11H2,1-3H3
InChI Key GKBDCSXIKLSKMH-UHFFFAOYSA-N
Purity 95%+
Complexity 561
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 379.14197277
Heavy Atom Count 28
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Monoisotopic Mass 379.14197277
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 60.4 Ų
Custom Q&A

What is the chemical name for the compound Bocconoline?

The chemical name for the compound Bocconoline is [1,3]Benzodioxolo[5,6-c]phenanthridine-13- methanol,12,13-dihydro-1,2-dimethoxy-12- methyl.

What are some synonyms for Bocconoline?

Some synonyms for Bocconoline include Bocconoline; 6-c]phenanthridine-13- methanol; 3]Benzodioxolo[5; 2-dimethoxy-12- methyl-; 13-dihydro-1.

What is the CAS number for Bocconoline?

The CAS number for Bocconoline is 32906-88-0.

What is the molecular formula of Bocconoline?

The molecular formula of Bocconoline is C22H21NO5.

What is the molecular weight of Bocconoline?

The molecular weight of Bocconoline is 379.40584.

What are the different elements present in Bocconoline?

Bocconoline contains carbon, hydrogen, nitrogen, and oxygen elements.

Is Bocconoline a naturally occurring compound?

Bocconoline is not a naturally occurring compound and is likely synthesized in a laboratory setting.

How can Bocconoline be used in research or applications?

Bocconoline may be used in research as a reference compound or in pharmaceutical applications for potential therapeutic benefits.

※ Please kindly note that our products are for research use only.