Bohemamine

Catalog Number	ACM72926126
CAS Number	72926-12-6
Molecular Weight	262.3
InChI	InChI=1S/C14H18N2O3/c1-7(2)5-11(18)15-10-6-9(17)14(4)13-12(19-13)8(3)16(10)14/h5-6,8,12-13H,1-4H3,(H,15,18)/t8-,12+,13+,14+/m0/s1
InChI Key	UARXZADXFDTXOF-OKVQYTGBSA-N
Melting Point	196-198 °C
Purity	95%+
Complexity	533
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	262.13174244
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@@H]2[C@@H](O2)[C@@]3(N1C(=CC3=O)NC(=O)C=C(C)C)C
Monoisotopic Mass	262.13174244
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	61.9 Ų

Custom Q&A

What is the product name of the compound with CAS number 72926-12-6?

The product name is bohemamine.

What are some synonyms for bohemamine?

One synonym for bohemamine is 2-Butenamide, 3-methyl-N-[(1aR,2S,6aS,6bS)-1a,6,6a,6b-tetrahydro-2,6a-dimethyl-6-oxo-2H-oxireno[a]pyrrolizin-4-yl

What is the molecular formula of bohemamine?

The molecular formula of bohemamine is C14H18N2O3.

What is the molecular weight of bohemamine?

The molecular weight of bohemamine is 262.3.

What is the melting point of bohemamine and in what solvent?

The melting point of bohemamine is 196-198 °C in chloroform.

What is the predicted boiling point of bohemamine?

The predicted boiling point of bohemamine is 474. 2±45.0 °C

What is the predicted density of bohemamine?

The predicted density of bohemamine is 1.27±0.1 g/cm3.

What is the pka value of bohemamine?

The pka value of bohemamine is 17.15±0.60.

Where does bohemamine occur naturally?

Bohemamine is a fungal metabolite that occurs in cultures of Actinosporangiurn strain C36145.

How does bohemamine appear when purified by recrystallization from EtOH?

Bohemamine appears as colourless needles when purified by recrystallization from EtOH.

※ Please kindly note that our products are for research use only.