Bosutinib

Catalog Number	ACM380843754
CAS Number	380843-75-4
Structure
IUPAC Name	4-(2,4-Dichloro-5-methoxyanilino)-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile
Molecular Weight	530.45
Molecular Formula	C26H29Cl2N5O3
Canonical SMILES	CN1CCN(CC1)CCCOC2=C(C=C3C(=C2)N=CC(=C3NC4=CC(=C(C=C4Cl)Cl)OC)C#N)OC
InChI	InChI=1S/C26H29Cl2N5O3/c1-32-6-8-33(9-7-32)5-4-10-36-25-13-21-18(11-24(25)35-3)26(17(15-29)16-30-21)31-22-14-23(34-2)20(28)12-19(22)27/h11-14,16H,4-10H2,1-3H3,(H,30,31)
InChI Key	UBPYILGKFZZVDX-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	734
Exact Mass	529.1647452
Heavy Atom Count	36
Monoisotopic Mass	529.1647452
Topological Polar Surface Area	82.9Ų

Custom Q&A

What is the chemical formula for Bosutinib?

Bosutinib has the chemical formula C26H29Cl2N5O3.

What is the melting point of Bosutinib?

The melting point of Bosutinib is 116-120 ºC.

What is the primary use of Bosutinib?

Bosutinib is primarily used for the treatment of chronic myeloid leukemia.

What is the chemical property of Bosutinib?

Bosutinib is described as a pale yellow solid.

How is Bosutinib metabolized in the body?

Bosutinib is mainly hepatically metabolized, with the major circulating metabolites being oxydechlorinated and N-desmethylated bosutinib.

What is the brand name of Bosutinib?

The brand name of Bosutinib is Bosulif.

What potential side effects are associated with Bosutinib?

Possible side effects of Bosutinib include nausea, stomach/abdominal pain, joint pain, and headache.

What is the mode of action of Bosutinib?

Bosutinib is a dual kinase inhibitor that targets both Abl and Src kinases, inhibiting cell growth and apoptosis.

How is Bosutinib stored?

Bosutinib is typically stored at room temperature or at +4°C.

What is the key biochem/physiol action of Bosutinib?

Bosutinib is a dual Src/Abl tyrosine kinase inhibitor with potent antiproliferative activity, making it effective against certain types of cancers.

※ Please kindly note that our products are for research use only.