Brevianamide F

Catalog Number	ACM38136708
CAS Number	38136-70-8
Structure
Synonyms	L-Prolyl-l-tryptophan anhydride
Molecular Weight	283.32
InChI	InChI=1S/C16H17N3O2/c20-15-14-6-3-7-19(14)16(21)13(18-15)8-10-9-17-12-5-2-1-4-11(10)12/h1-2,4-5,9,13-14,17H,3,6-8H2,(H,18,20)/t13-,14-/m0/s1
InChI Key	RYFZBPVMVYTEKZ-KBPBESRZSA-N
Melting Point	165-167 °C
Purity	95%+
Complexity	453
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	283.132076794
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C1C[C@H]2C(=O)N[C@H](C(=O)N2C1)CC3=CNC4=CC=CC=C43
Monoisotopic Mass	283.132076794
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	65.2 Ų

Custom Q&A

What is the chemical name for Brevianamide F?

The chemical name for Brevianamide F is Cyclo(L-Pro-L-Trp-).

What is the molecular formula of Brevianamide F?

The molecular formula of Brevianamide F is C16H17N3O2.

What is the melting point of Cyclo(L-Pro-L-Trp-)?

The melting point of Cyclo(L-Pro-L-Trp-) is 165-167 °C.

What is the storage temperature recommended for Cyclo(L-Pro-L-Trp-)?

The storage temperature recommended for Cyclo(L-Pro-L-Trp-) is 2-8°C.

What is the solubility of Cyclo(L-Pro-L-Trp-) in chloroform?

Cyclo(L-Pro-L-Trp-) is slightly soluble in chloroform.

How does Brevianamide F inhibit growth in certain bacteria strains?

Brevianamide F inhibits the growth of M. luteus and S. aureus when used at a concentration of 30 μg/disc.

What is the antifouling activity of Brevianamide F?

Brevianamide F has antifouling activity by inhibiting the attachment of B. neritina larvae to PVC plates.

What are some uses of Brevianamide F?

Brevianamide F is used in the preparation, reactions, and medicinal properties of diketopiperazines as bioactive natural products.

How is Brevianamide F obtained?

Brevianamide F is obtained by formal cyclocondensation of L-tryptophan and L-proline.

What is the chemical structure of Brevianamide F?

Brevianamide F is a pyrrolopyrazine that bears an indol-3-ylmethyl substituent at position 3.

※ Please kindly note that our products are for research use only.