Bripiodionene

Catalog Number	ACM190265704
CAS Number	190265-70-4
Molecular Weight	292.33
InChI	InChI=1S/C15H20N2O4/c1-7(2)14-8(3)4-5-10(21-14)12-13(19)9(6-11(16)18)17-15(12)20/h4-5,7-9,14H,6H2,1-3H3,(H2,16,18)(H,17,20)/b12-10+/t8-,9,14-/m1/s1
InChI Key	LKVLXIJSYMEIPY-JTKHMCLHSA-N
Purity	95%+
Complexity	548
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	292.14230712
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]1C=C/C(=C\2/C(=O)C(NC2=O)CC(=O)N)/O[C@@H]1C(C)C
Monoisotopic Mass	292.14230712
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	98.5 Ų

Custom Q&A

What is the chemical formula for Bripiodionene?

The chemical formula for Bripiodionene is C15H20N2O4.

What is the molecular weight of Bripiodionene?

The molecular weight of Bripiodionene is 292.33 g/mol.

What is the CAS number for Bripiodionene?

The CAS number for Bripiodionene is 190265-70-4.

What is the melting point of Bripiodionene?

The melting point of Bripiodionene is 195-198 °C.

What is the predicted boiling point of Bripiodionene?

The predicted boiling point of Bripiodionene is 576.1±50.0 °C.

What is the predicted density of Bripiodionene?

The predicted density of Bripiodionene is 1.208±0.06 g/cm3.

What is the predicted pKa value of Bripiodionene?

The predicted pKa value of Bripiodionene is 8.97±0.40.

What are some synonyms for Bripiodionene?

Some synonyms for Bripiodionene are 2-Pyrrolidineacetamide, and (4E)-rel-.

What is the stereochemistry of Bripiodionene?

The stereochemistry of Bripiodionene is defined as (5R,6R)-5,6-dihydro-5-methyl-6-(1-methylethyl)-2H-pyran-2-ylidene.

※ Please kindly note that our products are for research use only.