Broussonetine A

Catalog Number	ACM173220070
CAS Number	173220-07-0
IUPAC Name	1-Hydroxy-13-[(3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyrrolidin-2-yl]tridecan-4-one
Molecular Weight	507.62
Molecular Formula	C24H45NO10
Canonical SMILES	C(CCCCC1[C@H]([C@H]([C@H](N1)CO)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CCCCC(=O)CCCO
InChI	InChI=1S/C24H45NO10/c26-12-8-10-15(29)9-6-4-2-1-3-5-7-11-16-23(19(30)17(13-27)25-16)35-24-22(33)21(32)20(31)18(14-28)34-24/h16-28,30-33H,1-14H2/t16?,17-,18-,19+,20-,21+,22-,23-,24+/m1/s1
InChI Key	LYIJINGICVFWEP-OWASOCSESA-N
Purity	98%
Density	1.30±0.1 g/ml
Appearance	Powder
Complexity	597
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	8
Exact Mass	507.30434663
Heavy Atom Count	35
Hydrogen Bond Acceptor Count	11
Hydrogen Bond Donor Count	8
Isomeric SMILES	C(CCCCC1[C@H]([C@H]([C@H](N1)CO)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CCCCC(=O)CCCO
Monoisotopic Mass	507.30434663
PhysicalState	Powder
Rotatable Bond Count	17
Topological Polar Surface Area	189 Ų

Custom Q&A

What is the chemical formula of Broussonetine A?

The chemical formula of Broussonetine A is C24H45NO10.

What is the molar weight of Broussonetine A?

The molar weight of Broussonetine A is 507.62 g/mol.

What are some synonyms for Broussonetine A?

Some synonyms for Broussonetine A are 4-Tridecanone and 13-[(2R,3R,4S,5R)-3-(β-D-glucopyranosyloxy)-4-hydroxy-5-(hydroxymethyl)-2-pyrrolidinyl]-1-hydroxy-.

What are the product categories that Broussonetine A falls under?

Broussonetine A falls under product categories such as Alkaloids, chemical reagent, pharmaceutical intermediate, phytochemical, reference standards from Chinese medicinal herbs (TCM), and standardized herbal extract.

What is the boiling point of Broussonetine A?

The predicted boiling point of Broussonetine A is 750.7±60.0 °C.

In which solvents is Broussonetine A soluble?

Broussonetine A is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does Broussonetine A come in?

Broussonetine A comes in powder form.

What is the pKa value of Broussonetine A?

The predicted pKa value of Broussonetine A is 12.90±0.70.

How is Broussonetine A commonly used?

Broussonetine A is a new pyrrolizidine alkaloid that acts as an inhibitor of glycosidase.

What is the CAS number of Broussonetine A?

The CAS number of Broussonetine A is 173220-07-0.

※ Please kindly note that our products are for research use only.