Bullatine B

Bullatine B

Inquiry
Catalog Number ACM466262-1
CAS Number 466-26-2
Structure
Description Bullatine B, also known as neoline, is a natural steroid diterpenoid alkaloid found in plants of the Aconitum genre. Bullatine B is traditionally used to treat pain associated with exposure to cold temperatures. In 2020, NMR spectroscopy combined with X-ray crystallography have shown an unusual twisted-boat conformation of the bullatine B molecule.
Synonyms Neoline
Molecular Weight 437.57 g/mol
Molecular Formula C24H39NO6
Canonical SMILES CCN1CC2(CCC(C34C2C(C(C31)C5(CC(C6CC4C5C6O)OC)O)OC)O)COC
Storage store at 2℃-8℃
Harmonized Tariff Code Switzerland: 29061980 - USA: 2906195000 - Slovakia: 2906190090 - UK: 2906190000 - China: 2906190090
MDL Number MFCD01673484
Custom Q&A

What is the chemical name of Bullatine B?

Aconitane-1,8,14-triol, 20-ethyl-6,16-dimethoxy-4-(methoxymethyl)-, (1α,6α,14α,16β)-

What is the CAS number for Bullatine B?

466-26-2

What is the molecular formula of Bullatine B?

C24H39NO6

What are the product categories that Bullatine B falls under?

Chemical reagent, pharmaceutical intermediate, phytochemical, reference standards from Chinese medicinal herbs (TCM), standardized herbal extract

What is the melting point of Bullatine B?

153-154 °C

What is the boiling point of Bullatine B?

578.3±50.0 °C (Predicted)

What is the storage temperature recommended for Bullatine B?

2-8°C

What solvents is Bullatine B soluble in?

Chloroform (Sparingly), Methanol (Very Slightly)

What is the predicted pka value of Bullatine B?

13.32±0.70

What is the LD50 intraperitoneal toxicity in mice for Bullatine B?

150mg/kg

※ Please kindly note that our products are for research use only.