Buxifoliadine A

Catalog Number	ACM263007654
CAS Number	263007-65-4
Structure
IUPAC Name	1,5-Dihydroxy-3-methoxy-10-methyl-2,4-bis(3-methylbut-2-enyl)acridin-9-one
Molecular Weight	407.50
Molecular Formula	C25H29NO4
Canonical SMILES	CC(=CCC1=C2C(=C(C(=C1OC)CC=C(C)C)O)C(=O)C3=C(N2C)C(=CC=C3)O)C
InChI	InChI=1S/C25H29NO4/c1-14(2)10-12-17-22-20(24(29)18(25(17)30-6)13-11-15(3)4)23(28)16-8-7-9-19(27)21(16)26(22)5/h7-11,27,29H,12-13H2,1-6H3
InChI Key	XCHVRLXEQIEULZ-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	679
Exact Mass	407.20965841
Heavy Atom Count	30
Monoisotopic Mass	407.20965841
Topological Polar Surface Area	70Ų

Custom Q&A

What is the chemical formula for Buxifoliadine A?

The chemical formula for Buxifoliadine A is C25H29NO4.

What is the molecular weight of Buxifoliadine A?

The molecular weight of Buxifoliadine A is 407.5.

What is the CAS number for Buxifoliadine A?

The CAS number for Buxifoliadine A is 263007-65-4.

What are the synonyms for Buxifoliadine A?

The synonyms for Buxifoliadine A include 9(10H)-Acridinone, 1,5-dihydroxy-3-methoxy-10-methyl-2,4-bis(3-methyl-2-buten-1-yl)-.

What is the predicted boiling point of Buxifoliadine A?

The predicted boiling point of Buxifoliadine A is 612.4±55.0 °C.

What is the predicted density of Buxifoliadine A?

The predicted density of Buxifoliadine A is 1.177±0.06 g/cm3.

What is the predicted pKa of Buxifoliadine A?

The predicted pKa of Buxifoliadine A is 7.66±0.20.

What functional groups are present in Buxifoliadine A?

Buxifoliadine A contains hydroxyl, methoxy, and butenyl functional groups.

How many carbon atoms are present in Buxifoliadine A?

Buxifoliadine A contains 25 carbon atoms.

What is the molecular structure of Buxifoliadine A?

The molecular structure of Buxifoliadine A is 1,5-dihydroxy-3-methoxy-10-methyl-2,4-bis(3-methyl-2-buten-1-yl)-9(10H)-Acridinone.

※ Please kindly note that our products are for research use only.