Buxifoliadine B

Catalog Number	ACM263007665
CAS Number	263007-66-5
IUPAC Name	1,5-Dihydroxy-3-methoxy-2,4-bis(3-methylbut-2-enyl)-10H-acridin-9-one
Molecular Weight	393.48
Molecular Formula	C24H27NO4
Canonical SMILES	CC(=CCC1=C2C(=C(C(=C1OC)CC=C(C)C)O)C(=O)C3=C(N2)C(=CC=C3)O)C
InChI	InChI=1S/C24H27NO4/c1-13(2)9-11-16-21-19(22(27)15-7-6-8-18(26)20(15)25-21)23(28)17(24(16)29-5)12-10-14(3)4/h6-10,26,28H,11-12H2,1-5H3,(H,25,27)
InChI Key	WMXNOZZYTNVDSC-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	649
Exact Mass	393.19400834
Heavy Atom Count	29
Monoisotopic Mass	393.19400834
Topological Polar Surface Area	78.8Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 263007-66-5?

The product name is Buxifoliadine B.

What are the synonyms of Buxifoliadine B?

The synonyms are 9(10H)-Acridinone, 1,5-dihydroxy-3-methoxy-2,4-bis(3-methyl-2-buten-1-yl)-.

What is the molecular formula of Buxifoliadine B?

The molecular formula is C24H27NO4.

What is the molecular weight of Buxifoliadine B?

The molecular weight is 393.48.

What is the predicted boiling point of Buxifoliadine B?

The predicted boiling point is 564.3±50.0 °C.

What is the predicted density of Buxifoliadine B?

The predicted density is 1.188±0.06 g/cm3.

What is the predicted pka of Buxifoliadine B?

The predicted pka is 7.77±0.20.

What type of chemical compound is Buxifoliadine B?

Buxifoliadine B is an acridinone compound.

How many oxygen atoms are present in the chemical formula of Buxifoliadine B?

There are four oxygen atoms present.

What are the predicted chemical properties of Buxifoliadine B based on the information provided?

The predicted boiling point, density, and pka of Buxifoliadine B are provided in the reference.

※ Please kindly note that our products are for research use only.