Buxifoliadine H

Buxifoliadine H

Inquiry
Catalog Number ACM263007723
CAS Number 263007-72-3
Structure
Molecular Weight 317.29
InChI InChI=1S/C16H15NO6/c1-17-12-7(4-5-8(18)15(12)22-2)14(21)11-9(19)6-10(20)16(23-3)13(11)17/h4-6,18-20H,1-3H3
InChI Key KUASSSAVQTUJGE-UHFFFAOYSA-N
Purity 95%+
Complexity 460
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 317.0899372
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 7
Hydrogen Bond Donor Count 3
Monoisotopic Mass 317.0899372
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 99.5 Ų
Custom Q&A

What is the chemical formula of Buxifoliadine H?

The chemical formula of Buxifoliadine H is C16H15NO6.

What is the molecular weight of Buxifoliadine H?

The molecular weight of Buxifoliadine H is 317.29 g/mol.

What is the synonym of Buxifoliadine H?

The synonym of Buxifoliadine H is 9(10H)-Acridinone, 1,3,6-trihydroxy-4,5-dimethoxy-10-methyl.

What is the CAS number of Buxifoliadine H?

The CAS number of Buxifoliadine H is 263007-72-3.

What is the boiling point of Buxifoliadine H?

The boiling point of Buxifoliadine H is predicted to be 601.3±55.0 °C.

What is the predicted density of Buxifoliadine H?

The predicted density of Buxifoliadine H is 1.462±0.06 g/cm3.

What is the predicted pka value of Buxifoliadine H?

The predicted pka value of Buxifoliadine H is 7.22±0.20.

What are the key chemical properties of Buxifoliadine H?

The key chemical properties of Buxifoliadine H include its boiling point, density, and pka value.

What is the predicted boiling point and density of Buxifoliadine H according to the reference?

The predicted boiling point of Buxifoliadine H is 601.3±55.0 °C, and the predicted density is 1.462±0.06 g/cm3.

※ Please kindly note that our products are for research use only.