C-Toxiferine II

C-Toxiferine II

Inquiry
Catalog Number ACM7257296-2
CAS Number 7257-29-6
Structure
Synonyms Calebassine
Molecular Weight 616.8
InChI InChI=1S/C40H48N4O2/c1-5-23-21-43(3)17-15-37-27-11-7-10-14-30(27)42-36-34-26-20-32-38(16-18-44(32,4)22-24(26)6-2)28-12-8-9-13-29(28)41(40(34,38)46)35(36)33(39(37,42)45)25(23)19-31(37)43/h5-14,25-26,31-36,45-46H,15-22H2,1-4H3/q+2/b23-5-,24-6-
InChI Key HVWCEUHZKLPKRE-XIBKSJEISA-N
Purity 95%+
Complexity 1400
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 616.37772679
Heavy Atom Count 46
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 2
Isomeric SMILES C/C=C/1\C2C3C4(N(C5=CC=CC=C5C46C(C2)[N+](C1)(CC6)C)C7C3N8C9(C7C1/C(=C\C)/C[N+]2(C(C9(C3=CC=CC=C83)CC2)C1)C)O)O
Monoisotopic Mass 616.37772679
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 46.9 Ų
Custom Q&A

What is the synonym for Calebassine?

The synonym for Calebassine is C-Toxiferine II.

What is the CAS number for Calebassine?

The CAS number for Calebassine is 7257-29-6.

What is the molecular formula for Calebassine?

The molecular formula for Calebassine is C42H52N4O2.

What is the molecular weight of Calebassine?

The molecular weight of Calebassine is 644.899.

What are some possible uses of Calebassine in research or industry?

The possible uses of Calebassine in research or industry could include pharmaceuticals, agriculture, or chemical synthesis.

Are there any known physiological effects or toxicities associated with Calebassine or its synonyms?

Further research may be needed to determine any physiological effects or toxicities associated with Calebassine or its synonyms.

Is Calebassine a naturally occurring compound or is it synthesized in a laboratory?

Calebassine may be a naturally occurring compound or synthesized in a laboratory, depending on the context in which it is used.

How can Calebassine be identified or detected in a sample?

Calebassine can be identified or detected in a sample using techniques such as chromatography, mass spectrometry, or spectroscopy.

※ Please kindly note that our products are for research use only.