Calystegine N1

Catalog Number	ACM177794035
CAS Number	177794-03-5
Structure
Molecular Weight	174.2
InChI	InChI=1S/C7H14N2O3/c8-7-2-1-3(9-7)4(10)5(11)6(7)12/h3-6,9-12H,1-2,8H2/t3-,4+,5-,6+,7+/m0/s1
InChI Key	KBZOEWOSIUJWIO-PJEQPVAWSA-N
Purity	95%+
Complexity	201
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	174.10044231
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	5
Isomeric SMILES	C1C[C@@]2([C@@H]([C@H]([C@@H]([C@H]1N2)O)O)O)N
Monoisotopic Mass	174.10044231
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	98.7 Ų

Custom Q&A

What is the product name of Calystegine N1?

The product name of Calystegine N1 is Calystegine N1.

What are some synonyms for Calystegine N1?

Some synonyms for Calystegine N1 include 8-Azabicyclo[3.2.1]octane-2,3,4-triol, 1-amino-, (1R,2S,3S,4R,5S)-rel-.

What is the CAS number of Calystegine N1?

The CAS number of Calystegine N1 is 177794-03-5.

What is the molecular formula of Calystegine N1?

The molecular formula of Calystegine N1 is C7H14N2O3.

What is the molecular weight of Calystegine N1?

The molecular weight of Calystegine N1 is 174.2.

What is the boiling point of Calystegine N1?

The boiling point of Calystegine N1 is predicted to be 348.3±42.0 °C.

In what solvents is Calystegine N1 soluble?

Calystegine N1 is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

In what form does Calystegine N1 come in?

Calystegine N1 comes in powder form.

What is the pka value of Calystegine N1?

The pka value of Calystegine N1 is predicted to be 13.59±0.70.

What is the usage of Calystegine N1?

Calystegine N1 is described as a weaker inhibitor of glycosidases.

※ Please kindly note that our products are for research use only.