Camptothecin

Catalog Number	ACM7689034
CAS Number	7689-03-4
Structure
Description	Camptothecin (CPT), a kind of alkaloid, is a DNA topoisomerase I (Topo I) inhibitor with an IC50 of 679 nM. Camptothecin (CPT) exhibits powerful antineoplastic activity against colorectal, breast, lung and ovarian cancers, modulates hypoxia-inducible factor-1α (HIF-1α) activity by changing microRNAs (miRNA) expression patterns in human cancer cells.
Synonyms	(S)-(+)-Camptothecin
Molecular Weight	348.4
InChI	InChI=1S/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3/t20-/m0/s1
InChI Key	VSJKWCGYPAHWDS-FQEVSTJZSA-N
Melting Point	260 °C
Purity	98%+
Complexity	742
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	348.111007
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=CC5=CC=CC=C5N=C4C3=C2)O
Monoisotopic Mass	348.111007
PhysicalState	Solid
Rotatable Bond Count	1
Topological Polar Surface Area	79.7 Ų

Custom Q&A

What is the chemical formula of (+)-Camptothecin?

The chemical formula of (+)-Camptothecin is C20H16N2O4.

What is the melting point of (+)-Camptothecin?

The melting point of (+)-Camptothecin is 260 °C.

What is the main medicinal part of Camptotheca acuminata?

The main medicinal parts of Camptotheca acuminata are the root bark and fruit.

What is the traditional Chinese medicine Camptotheca acuminata used for?

Camptotheca acuminata is used to get rid of heat, toxic materials, and eliminate disease.

How does Camptothecin exert its anticancer activity?

Camptothecin inhibits the DNA enzyme topoisomerase I, inducing DNA strand breaks and inhibiting DNA and RNA synthesis in mammalian cells.

What is the specific effect of Camptothecin on the cell cycle?

Camptothecin mainly influences the S phase of the cell cycle and is considered a specific inhibitor agent of the cell cycle.

What is the precursor of 10-hydroxycamptothecine?

The precursor of 10-hydroxycamptothecine is Camptothecin.

What is the main usage of Camptothecin in terms of cancer treatment?

Camptothecin is mainly used in digestive tract tumors such as gastric cancer, rectal cancer, and colon cancer.

How does Camptothecin interact with the DNA-topoisomerase I complex?

Camptothecin binds irreversibly to the DNA-topoisomerase I complex, inhibiting the reassociation of DNA after cleavage by topoisomerase I and trapping the enzyme in a covalent linkage with DNA.

What are some of the water-soluble derivatives of Camptothecin that have been successfully used for cancer treatment?

Topotecan and irinotecan are water-soluble derivatives of Camptothecin that have been successfully used for the treatment of ovarian, lung, and colorectal cancers.

※ Please kindly note that our products are for research use only.