Canthin-6-one

Catalog Number	ACM479436
CAS Number	479-43-6
Synonyms	6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one
Molecular Weight	220.23
InChI	InChI=1S/C14H8N2O/c17-13-6-5-11-14-10(7-8-15-11)9-3-1-2-4-12(9)16(13)14/h1-8H
InChI Key	ZERVJPYNQLONEK-UHFFFAOYSA-N
Melting Point	161-161.5 °C
Purity	95%+
Complexity	378
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	220.063662883
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	220.063662883
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	34.9 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 479-43-6?

Canthin-6-one

What are some synonyms for Canthin-6-one?

Canthin-3-one, 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one

What is the molecular formula of Canthin-6-one?

C14H8N2O

What is the molecular weight of Canthin-6-one?

220.23

What is the melting point of Canthin-6-one?

161-161.5 °C

In what temperature range does Canthin-6-one boil?

346.5±34.0 °C

What is the storage temperature recommended for Canthin-6-one?

Refrigerator

What are the solubilities of Canthin-6-one in chloroform and methanol?

Slightly soluble in both

What is the pka value predicted for Canthin-6-one?

4.40±0.20

How is Canthin-6-one used in the field of medicine?

It is used as an anticancer agent against multi-drug resistant cancer cells and in the synthesis of antimalarial agents.

※ Please kindly note that our products are for research use only.