Canthin-6-one N-oxide

Catalog Number	ACM60755875
CAS Number	60755-87-5
Synonyms	Cathin-6-one 3-oxide
Molecular Weight	236.22
InChI	InChI=1S/C14H8N2O2/c17-13-6-5-12-14-10(7-8-15(12)18)9-3-1-2-4-11(9)16(13)14/h1-8H
InChI Key	PMKULNRVYULJPO-UHFFFAOYSA-N
Purity	95%+
Complexity	409
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	236.058577502
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	236.058577502
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	47.5 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 60755-87-5?

The chemical name is Canthin-6-one N-oxide.

What are some synonyms for Canthin-6-one N-oxide?

Some synonyms include Cathin-6-one 3-oxide and 3-oxy-indolo[3,2,1-de][1,5]naphthyridin-6-one.

What is the molecular formula of Canthin-6-one N-oxide?

The molecular formula is C14H8N2O2.

What is the molecular weight of Canthin-6-one N-oxide?

The molecular weight is 236.23.

How can Canthin-6-one N-oxide be represented?

It can be represented as C14H8N2O2.

What is the CAS number of Canthin-6-one N-oxide?

The CAS number is 60755-87-5.

What are the elements present in the molecular formula of Canthin-6-one N-oxide?

The elements are carbon, hydrogen, nitrogen, and oxygen.

Can Canthin-6-one N-oxide be used in pharmacology or organic chemistry?

Yes, it can be used in pharmacology and organic chemistry.

What is the IUPAC name of Canthin-6-one N-oxide?

The IUPAC name is (6-oxidanylidenemethyl-1H-indol-2-yl)methanone.

※ Please kindly note that our products are for research use only.