Capsaicin beta-D-glucopyranoside

Catalog Number	ACM153409166
CAS Number	153409-16-6
Structure
Synonyms	Capsaicin β-D-glucopyranoside
Molecular Weight	467.6
InChI	InChI=1S/C24H37NO8/c1-15(2)8-6-4-5-7-9-20(27)25-13-16-10-11-17(18(12-16)31-3)32-24-23(30)22(29)21(28)19(14-26)33-24/h6,8,10-12,15,19,21-24,26,28-30H,4-5,7,9,13-14H2,1-3H3,(H,25,27)/b8-6+
InChI Key	HEYWYCJIIXVRPS-SOFGYWHQSA-N
Purity	98%+
Complexity	601
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	467.25191714
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	5
Isomeric SMILES	CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)OC
Monoisotopic Mass	467.25191714
PhysicalState	Solid
Rotatable Bond Count	12
Topological Polar Surface Area	138 Ų

Custom Q&A

What is the chemical formula of Capsaicin beta-D-Glucopyranoside?

The chemical formula of Capsaicin beta-D-Glucopyranoside is C24H37NO8.

What is the molecular weight of Capsaicin beta-D-Glucopyranoside?

The molecular weight of Capsaicin beta-D-Glucopyranoside is 467.55.

What is the boiling point of Capsaicin beta-D-Glucopyranoside?

The predicted boiling point of Capsaicin beta-D-Glucopyranoside is 709.4±60.0 °C.

What is the density of Capsaicin beta-D-Glucopyranoside?

The predicted density of Capsaicin beta-D-Glucopyranoside is 1.224±0.06 g/cm3.

How should Capsaicin beta-D-Glucopyranoside be stored?

Capsaicin beta-D-Glucopyranoside should be stored at a temperature below 0°C.

What is the color of Capsaicin beta-D-Glucopyranoside?

Capsaicin beta-D-Glucopyranoside is white to almost white in color.

What is the predicted pka value of Capsaicin beta-D-Glucopyranoside?

The predicted pka value of Capsaicin beta-D-Glucopyranoside is 12.81±0.70.

What is the HS Code for Capsaicin beta-D-Glucopyranoside?

The HS Code for Capsaicin beta-D-Glucopyranoside is 2938.90.0000.

What are some synonyms for Capsaicin beta-D-Glucopyranoside?

Some synonyms for Capsaicin beta-D-Glucopyranoside include Capsaicin β-D-Glucopyranoside, -D-Glucopyranoside, and Capsaicin βCapsaicin beta-D-Glucopyranoside.

In what form is Capsaicin beta-D-Glucopyranoside usually found?

Capsaicin beta-D-Glucopyranoside is commonly found in the form of powder to crystal.

※ Please kindly note that our products are for research use only.