Cartric

Catalog Number	ACM24815245-1
CAS Number	24815-24-5
Structure
Description	Cartric is a sample preparation reagent that can be used for the detection of infectious diseases. It has been used in analytical methods to measure redox potentials and systolic pressure. Cartric also has been shown to inhibit enzymes, such as hydroxyl group reductase, which are involved in the metabolism of drugs and other xenobiotics. This product is not cytotoxic and does not interfere with the fluorescence detector. Cartric can be used in vitro for the detection of carcinoma cell lines and p-hydroxybenzoic acid.
Synonyms	RescinnamineMethyl 3,4,5-trimethoxycinnamoyl reserpatePubescine
Molecular Weight	634.72 g/mol
Molecular Formula	C35H42N2O9
Canonical SMILES	CO[C@H]1[C@@H](C[C@@H]2CN3CCC4=C([C@H]3C[C@@H]2[C@@H]1C(=O)OC)NC5=C4C=CC(=C5)OC)OC(=O)/C=C/C6=CC(=C(C(=C6)OC)OC)OC
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29339910 - USA: 2933999701 - Slovakia: 2933991000 - UK: 2933998000 - China: 2933990000
MDL Number	MFCD00005092

Custom Q&A

What is the chemical name of RESCINNAMINE?

Yohimban-16-carboxylic acid, 11,17-dimethoxy-18-[[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]oxy]-, methyl ester

What is the CAS number of RESCINNAMINE?

24815-24-5

What is the molecular formula of RESCINNAMINE?

C35H42N2O9

What is the melting point of RESCINNAMINE?

238-239°C

What is the storage temperature recommended for RESCINNAMINE?

2-8°C

In which Rauwolfia species is RESCINNAMINE found?

R. serpentina and R. vomitora

What is a common therapeutic use of RESCINNAMINE?

As an antihypertensive agent

What is the Brand name of RESCINNAMINE?

Moderil (Pfizer)

How does RESCINNAMINE react to light exposure?

It darkens slowly

What are the potential side effects of RESCINNAMINE?

Excessive doses may produce depression, nightmare, nausea, diarrhea, and hypotension.

※ Please kindly note that our products are for research use only.