Cassamedine

Catalog Number	ACM16408756
CAS Number	16408-75-6
IUPAC Name	17-Methoxy-5,7,19,21-tetraoxa-13-azahexacyclo[10.10.1.02,10.04,8.016,23.018,22]tricosa-1(22),2,4(8),9,12,14,16(23),17-octaen-11-one
Molecular Weight	349.29
Molecular Formula	C19H11NO6
Canonical SMILES	COC1=C2C(=C3C4=CC5=C(C=C4C(=O)C6=NC=CC1=C36)OCO5)OCO2
InChI	InChI=1S/C19H11NO6/c1-22-17-8-2-3-20-15-13(8)14(18-19(17)26-7-25-18)9-4-11-12(24-6-23-11)5-10(9)16(15)21/h2-5H,6-7H2,1H3
InChI Key	DQFLZSJFIQYSGC-UHFFFAOYSA-N
Purity	90%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	601
Exact Mass	349.05863707
Heavy Atom Count	26
Monoisotopic Mass	349.05863707
Topological Polar Surface Area	76.1Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 16408-75-6?

The product name is Cassamedine.

What are the synonyms for the chemical compound Cassamedine?

One synonym for Cassamedine is 8H-Bis[1,3]benzodioxolo[6,5,4-de:5',6'-g]quinolin-8-one, 4-methoxy-.

What is the molecular formula of Cassamedine?

The molecular formula is C19H11NO6.

What is the molar weight of Cassamedine?

The molar weight is 349.29 g/mol.

What is the boiling point of Cassamedine?

The boiling point is predicted to be 629.8±55.0 °C.

What is the predicted density of Cassamedine?

The predicted density is 1.598±0.06 g/cm3.

What is the predicted pka value of Cassamedine?

The predicted pka value is 1.69±0.20.

How many oxygen atoms are present in the molecular formula of Cassamedine?

There are 6 oxygen atoms present in the molecular formula.

What is the predicted boiling point range for Cassamedine?

The boiling point range is predicted to be 55.0 °C.

What is the predicted molecular weight of Cassamedine?

The predicted molecular weight is 349.29 g/mol.

※ Please kindly note that our products are for research use only.