Cassipourine

Catalog Number	ACM14051106
CAS Number	14051-10-6
Molecular Weight	346.6
InChI	InChI=1S/C14H22N2S4/c1-3-9-13-11(7-15(9)5-1)17-18-12-8-16-6-2-4-10(16)14(12)20-19-13/h9-14H,1-8H2/t9-,10-,11-,12-,13-,14-/m0/s1
InChI Key	DAZPQMCIGXENBY-LHEWDLALSA-N
Purity	95%+
Complexity	359
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	346.0665834
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1C[C@H]2[C@H]3[C@H](CN2C1)SS[C@H]4CN5CCC[C@H]5[C@@H]4SS3
Monoisotopic Mass	346.0665834
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	108 Ų

Custom Q&A

What is the chemical formula for Cassipourine?

The chemical formula for Cassipourine is C14H22N2S4.

What is the molecular weight of Cassipourine?

The molecular weight of Cassipourine is 346.58 g/mol.

What is the CAS number for Cassipourine?

The CAS number for Cassipourine is 14051-10-6.

What is the predicted boiling point of Cassipourine?

The predicted boiling point of Cassipourine is 489.9±45.0 °C.

What is the predicted density of Cassipourine?

The predicted density of Cassipourine is 1.45±0.1 g/cm3.

What is the predicted pka value of Cassipourine?

The predicted pka value of Cassipourine is 8.76±0.20.

Is Cassipourine a solid, liquid, or gas at room temperature?

Cassipourine is a solid at room temperature with a melting point of 212 °C.

Are there any synonyms for Cassipourine?

One synonym for Cassipourine is: 1H,6H-[1,2,5,6]Tetrathiocino[3,4-a:8,7-a']dipyrrolizine, dodecahydro-, (3aR,3bR,5aR,5bR,10aR,12aR)-rel-(-)- (9CI).

How many nitrogen atoms are present in the molecular formula of Cassipourine?

There are two nitrogen atoms present in the molecular formula of Cassipourine.

※ Please kindly note that our products are for research use only.