Caulophine

Caulophine

Inquiry
Catalog Number ACM1159989191
CAS Number 1159989-19-1
Molecular Weight 343.4
InChI InChI=1S/C19H21NO5/c1-20(2)8-7-10-9-13(25-4)15-16(17(10)21)14-11(18(15)22)5-6-12(24-3)19(14)23/h5-6,9,21,23H,7-8H2,1-4H3
InChI Key NDCDKMMCPZJBEB-UHFFFAOYSA-N
Purity 95%+
Complexity 484
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 343.14197277
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 2
Monoisotopic Mass 343.14197277
PhysicalState Powder
Rotatable Bond Count 5
Topological Polar Surface Area 79.2 Ų
Custom Q&A

What is the chemical formula for Caulophine?

The chemical formula for Caulophine is C19H21NO5.

What is the molecular weight of Caulophine?

The molecular weight of Caulophine is 343.37.

What is the boiling point of Caulophine?

The boiling point of Caulophine is predicted to be 576.1±50.0 °C.

What is the density of Caulophine?

The density of Caulophine is predicted to be 1.306±0.06 g/cm3.

What is the pka value of Caulophine?

The pka value of Caulophine is predicted to be 7.45±0.20.

Where is Caulophine isolated from?

Caulophine is isolated from the radix of Caulophyllum robustum.

What activity does Caulophine exhibit?

Caulophine exhibits anti-myocardial ischemia activity.

What role does Caulophine play?

Caulophine has a role as a metabolite and a cardiovascular drug.

What class does Caulophine belong to?

Caulophine is a member of the class of fluoren-9-ones.

What are some chemical properties of Caulophine?

Some chemical properties of Caulophine include being a tertiary amino compound, a polyphenol, an aromatic ether, and an alkaloid.

※ Please kindly note that our products are for research use only.