Caulophylline B

Caulophylline B

Inquiry
Catalog Number ACM1359978554
CAS Number 1359978-55-4
Molecular Weight 343.4
InChI InChI=1S/C19H21NO5/c1-20(2)8-7-10-9-13(25-4)19(23)16-14(10)17(21)11-5-6-12(24-3)18(22)15(11)16/h5-6,9,22-23H,7-8H2,1-4H3
InChI Key NAQHNUUPLJAHRT-UHFFFAOYSA-N
Purity 95%+
Complexity 484
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 343.14197277
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 2
Monoisotopic Mass 343.14197277
PhysicalState Powder
Rotatable Bond Count 5
Topological Polar Surface Area 79.2 Ų
Custom Q&A

What is the product name of Caulophylline B?

The product name of Caulophylline B is Caulophylline B.

What are some synonyms of Caulophylline B?

Some synonyms of Caulophylline B include 9H-Fluoren-9-one, 1-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3,6-dimethoxy.

What is the CAS number of Caulophylline B?

The CAS number of Caulophylline B is 1359978-55-4.

What is the molecular formula of Caulophylline B?

The molecular formula of Caulophylline B is C19H21NO5.

What is the molecular weight of Caulophylline B?

The molecular weight of Caulophylline B is 343.37.

What is the boiling point of Caulophylline B?

The boiling point of Caulophylline B is predicted to be 569.2±50.0 °C.

What is the density of Caulophylline B?

The density of Caulophylline B is predicted to be 1.306±0.06 g/cm3.

What is the pka value of Caulophylline B?

The pka value of Caulophylline B is predicted to be 7.73±0.20.

Based on the chemical properties, what can be predicted about the solubility of Caulophylline B?

Based on the high boiling point and density, Caulophylline B may have low solubility in water.

How can Caulophylline B be used in different industries based on its chemical properties?

Caulophylline B's chemical properties may make it suitable for use in pharmaceuticals, cosmetics, or research laboratories.

※ Please kindly note that our products are for research use only.