- Home
- Products
- Other Alkaloids
- Caulophylline B
- Home
- About Us
- Products
- Services
- Markets
- Order Center
- Contact Us
Catalog Number | ACM1359978554 |
CAS Number | 1359978-55-4 |
Molecular Weight | 343.4 |
InChI | InChI=1S/C19H21NO5/c1-20(2)8-7-10-9-13(25-4)19(23)16-14(10)17(21)11-5-6-12(24-3)18(22)15(11)16/h5-6,9,22-23H,7-8H2,1-4H3 |
InChI Key | NAQHNUUPLJAHRT-UHFFFAOYSA-N |
Purity | 95%+ |
Complexity | 484 |
Covalently-Bonded Unit Count | 1 |
Defined Atom Stereocenter Count | 0 |
Exact Mass | 343.14197277 |
Heavy Atom Count | 25 |
Hydrogen Bond Acceptor Count | 6 |
Hydrogen Bond Donor Count | 2 |
Monoisotopic Mass | 343.14197277 |
PhysicalState | Powder |
Rotatable Bond Count | 5 |
Topological Polar Surface Area | 79.2 Ų |
What is the product name of Caulophylline B?
The product name of Caulophylline B is Caulophylline B.
What are some synonyms of Caulophylline B?
Some synonyms of Caulophylline B include 9H-Fluoren-9-one, 1-[2-(dimethylamino)ethyl]-4,5-dihydroxy-3,6-dimethoxy.
What is the CAS number of Caulophylline B?
The CAS number of Caulophylline B is 1359978-55-4.
What is the molecular formula of Caulophylline B?
The molecular formula of Caulophylline B is C19H21NO5.
What is the molecular weight of Caulophylline B?
The molecular weight of Caulophylline B is 343.37.
What is the boiling point of Caulophylline B?
The boiling point of Caulophylline B is predicted to be 569.2±50.0 °C.
What is the density of Caulophylline B?
The density of Caulophylline B is predicted to be 1.306±0.06 g/cm3.
What is the pka value of Caulophylline B?
The pka value of Caulophylline B is predicted to be 7.73±0.20.
Based on the chemical properties, what can be predicted about the solubility of Caulophylline B?
Based on the high boiling point and density, Caulophylline B may have low solubility in water.
How can Caulophylline B be used in different industries based on its chemical properties?
Caulophylline B's chemical properties may make it suitable for use in pharmaceuticals, cosmetics, or research laboratories.
※ Please kindly note that our products are for research use only.
Privacy Policy | Cookie Policy | Copyright © 2025 Alfa Chemistry. All rights reserved.