Caulophyllumine A

Catalog Number	ACM1009318608
CAS Number	1009318-60-8
Molecular Weight	279.33
InChI	InChI=1S/C15H21NO4/c1-19-14-11(6-7-12(17)15(14)20-2)13(18)9-10-5-3-4-8-16-10/h6-7,10,16-17H,3-5,8-9H2,1-2H3/t10-/m0/s1
InChI Key	MCMMIRWNWGZONI-JTQLQIEISA-N
Purity	95%+
Complexity	323
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	279.14705815
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	COC1=C(C=CC(=C1OC)O)C(=O)C[C@@H]2CCCCN2
Monoisotopic Mass	279.14705815
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	67.8 Ų

Custom Q&A

What is the chemical formula of Caulophyllumine A?

The chemical formula of Caulophyllumine A is C15H21NO4.

What is the molecular weight of Caulophyllumine A?

The molecular weight of Caulophyllumine A is 279.33.

What is the boiling point of Caulophyllumine A?

The boiling point of Caulophyllumine A is predicted to be 451.8±40.0 °C.

What is the density of Caulophyllumine A?

The density of Caulophyllumine A is predicted to be 1.135±0.06 g/cm3.

What is the pKa value of Caulophyllumine A?

The pKa value of Caulophyllumine A is predicted to be 7.59±0.25.

Where is Caulophyllumine A isolated from?

Caulophyllumine A is an alkaloid isolated from Blue cohosh (Caulophyllum thalictroides).

What is Caulophyllumine A primarily used for?

Caulophyllumine A is primarily used to cure menstrual disturbances and to ease childbirth.

What is the common name of Caulophyllum thalictroides?

Blue cohosh is the common name of Caulophyllum thalictroides.

Can Caulophyllumine A be used for medicinal purposes?

Yes, Caulophyllumine A can be used for medicinal purposes to treat menstrual disturbances and aid in childbirth.

What are some of the predicted chemical properties of Caulophyllumine A?

Some of the predicted chemical properties of Caulophyllumine A include boiling point, density, and pKa value.

※ Please kindly note that our products are for research use only.