Cephalandole B

Catalog Number	ACM915315445
CAS Number	915315-44-5
IUPAC Name	Methyl 2-(1H-indole-3-carbonylamino)benzoate
Molecular Weight	294.30
Molecular Formula	C17H14N2O3
Canonical SMILES	COC(=O)C1=CC=CC=C1NC(=O)C2=CNC3=CC=CC=C32
InChI	InChI=1S/C17H14N2O3/c1-22-17(21)12-7-3-5-9-15(12)19-16(20)13-10-18-14-8-4-2-6-11(13)14/h2-10,18H,1H3,(H,19,20)
InChI Key	XEHQWFSGHCYKCH-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	426
Exact Mass	294.10044231
Heavy Atom Count	22
Monoisotopic Mass	294.10044231
Topological Polar Surface Area	71.2Ų

Custom Q&A

What is the full chemical name for Cephalandole B?

The full chemical name for Cephalandole B is Benzoic acid, 2-[(1H-indol-3-ylcarbonyl)amino]-, methyl ester.

What are some synonyms for Cephalandole B?

Some synonyms for Cephalandole B are cephalandole B.

What is the CAS number for Cephalandole B?

The CAS number for Cephalandole B is 915315-44-5.

What is the molecular formula of Cephalandole B?

The molecular formula of Cephalandole B is C17H14N2O3.

What is the molecular weight of Cephalandole B?

The molecular weight of Cephalandole B is 294.31.

What is the melting point of Cephalandole B?

The melting point of Cephalandole B is 179.5-180 °C.

What is the solvency used to measure the melting point of Cephalandole B?

The solvency used to measure the melting point of Cephalandole B is ethyl ether.

What is the boiling point of Cephalandole B?

The boiling point of Cephalandole B is 431.3±25.0 °C.

What is the predicted density of Cephalandole B?

The predicted density of Cephalandole B is 1.346±0.06 g/cm3.

What is the predicted pka value of Cephalandole B?

The predicted pka value of Cephalandole B is 14.26±0.70.

※ Please kindly note that our products are for research use only.