Cepharadione B

Cepharadione B

Inquiry
Catalog Number ACM55610021
CAS Number 55610-02-1
Structure
Synonyms 1,2-Dimethoxy-6-methyl-4H-dibenzo[de,g]quinoline-4,5(6H)-dione
Molecular Weight 321.3
InChI InChI=1S/C19H15NO4/c1-20-13-8-10-6-4-5-7-11(10)16-15(13)12(17(21)19(20)22)9-14(23-2)18(16)24-3/h4-9H,1-3H3
InChI Key AFKGBLKLNRDQFN-UHFFFAOYSA-N
Purity 95%+
Complexity 536
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 321.10010796
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 0
Monoisotopic Mass 321.10010796
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 55.8 Ų
Custom Q&A

What is the chemical name of Cepharadione B?

1,2-Dimethoxy-6-methyl-4H-dibenzo[de,g]quinoline-4,5(6H)-dione

What are some synonyms for Cepharadione B?

Cepharadione B; 4H-Dibenzo[de,g]quinoline-4,5(6H)-dione, 1,2-dimethoxy-6-methyl-

What is the CAS number for Cepharadione B?

55610-02-1

What is the molecular formula of Cepharadione B?

C19H15NO4

What is the molecular weight of Cepharadione B?

321.33

Where is Cepharadione B obtained from?

Cepharadione B is obtained from the callus tissue of Stephania cepharantha.

What is the color of Cepharadione B?

Cepharadione B forms orange needles and gives a bright orange fluorescence.

What are the absorption maxima in the ultraviolet spectrum of Cepharadione B in EtOH?

213, 244, 303, 315, and 440 nm with a shoulder at 273 nm

What is Cepharadione B functionally related to?

Cepharadione B is functionally related to an aporphine.

Which researchers were referenced for information on Cepharadione B?

Akasu, Itokawa, and Fujita, Tetrahedron Lett., 3609 (1974)

※ Please kindly note that our products are for research use only.