Cernuine

Catalog Number	ACM6880848
CAS Number	6880-84-8
Synonyms	12-Deoxylycocernuine
Molecular Weight	262.39
InChI	InChI=1S/C16H26N2O/c1-11-8-12-4-2-6-15-17(12)14(9-11)10-13-5-3-7-16(19)18(13)15/h11-15H,2-10H2,1H3/t11-,12-,13-,14+,15-/m0/s1
InChI Key	IWSJXTCXZSUCNS-LXFSFDBISA-N
Purity	90%+
Complexity	383
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	262.204513457
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@H]1C[C@@H]2CCC[C@H]3N2[C@H](C1)C[C@H]4N3C(=O)CCC4
Monoisotopic Mass	262.204513457
PhysicalState	Oil
Rotatable Bond Count	0
Topological Polar Surface Area	23.6 Ų

Custom Q&A

What is the chemical name of Cernuine?

The chemical name of Cernuine is (3aS)-1,2,3,3a,4,5,6,6aβ,7,7aβ,8,9,10,12aα-Tetradecahydro-5α-methyl-11H-pyrido[1',2':3,4]pyrimido[2,1,6-de]quinolizin-11-one.

What is the molecular formula of Cernuine?

The molecular formula of Cernuine is C16H26N2O.

What is the CAS number of Cernuine?

The CAS number of Cernuine is 6880-84-8.

What is the molecular weight of Cernuine?

The molecular weight of Cernuine is 262.39 g/mol.

What is the synonym for Cernuine?

Some synonyms for Cernuine include Cernuine, 12-Deoxylycocernuine, and (3aS,5S,6aR,7aS,12aS)-12-Deoxylycocernuine.

What is the classification of Cernuine?

Cernuine is classified as a member of quinolizidines.

What is the structure of Cernuine?

The structure of Cernuine is (3aS)-1,2,3,3a,4,5,6,6aβ,7,7aβ,8,9,10,12aα-Tetradecahydro-5α-methyl-11H-pyrido[1',2':3,4]pyrimido[2,1,6-de]quinolizin-11-one.

What is the chemical composition of Cernuine?

The chemical composition of Cernuine includes carbon, hydrogen, nitrogen, and oxygen atoms.

Can Cernuine be used in synthesis processes?

Yes, Cernuine can be used in synthesis processes.

What is the role of Cernuine in quinolizidines?

Cernuine acts as a member of quinolizidines, a class of compounds with specific chemical structures and properties.

※ Please kindly note that our products are for research use only.