Chalcostrobamine

Catalog Number	ACM75638721
CAS Number	75638-72-1
Molecular Weight	269.34
InChI	InChI=1S/C17H19NO2/c1-18-13-8-9-14(18)17(16(20)11-13)15(19)10-7-12-5-3-2-4-6-12/h2-7,10,13-14,19H,8-9,11H2,1H3/b10-7+,17-15-/t13,14-/m1/s1
InChI Key	WWLJBJUDIYRTRU-XCNQMEBBSA-N
Purity	95%+
Complexity	446
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	269.141578849
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1[C@@H]\2CCC1CC(=O)/C2=C(/C=C/C3=CC=CC=C3)\O
Monoisotopic Mass	269.141578849
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical formula of Chalcostrobamine?

The chemical formula of Chalcostrobamine is C17H19NO2.

What is the CAS number for Chalcostrobamine?

The CAS number for Chalcostrobamine is 75638-72-1.

What is the molecular weight of Chalcostrobamine?

The molecular weight of Chalcostrobamine is 269.34 g/mol.

What is the predicted boiling point of Chalcostrobamine?

The predicted boiling point of Chalcostrobamine is 439.4±45.0 °C.

In which plant does Chalcostrobamine occur naturally?

Chalcostrobamine occurs in the ethanolic extract of Knightia strobilina.

What is the specific rotation of Chalcostrobamine?

Chalcostrobamine has a specific rotation of [α]D + 12° (CHCl3).

What is the predicted density of Chalcostrobamine?

The predicted density of Chalcostrobamine is 1.222±0.06 g/cm3.

What is the predicted pKa value of Chalcostrobamine?

The predicted pKa value of Chalcostrobamine is 4.50±1.00.

What are some synonyms for Chalcostrobamine?

Some synonyms for Chalcostrobamine include 2-Propen-1-one and (2E)-1-[(1R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl]-3-phenyl-.

Which alkaloid group does Chalcostrobamine belong to?

Chalcostrobamine is a tropane alkaloid.

※ Please kindly note that our products are for research use only.