Chelerythrine chloride

Chelerythrine chloride

Inquiry
Catalog Number ACM3895929
CAS Number 3895-92-9
Structure
Description Chelerythrine chloride is a potent, cell-permeable inhibitor of protein kinase C, with an IC50 of 660 nM. Chelerythrine chloride inhibits the Bcl-XL-Bak BH3 peptide binding with IC50 of 1.5 μM and displaces Bax from Bcl-XL. Chelerythrine chloride induces apoptosis and autophagy.
Synonyms 1,2-Dimethoxy-12-methyl-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-12-ium chloride
Molecular Weight 383.8
InChI InChI=1S/C21H18NO4.ClH/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22;/h4-10H,11H2,1-3H3;1H/q+1;/p-1
InChI Key WEEFNMFMNMASJY-UHFFFAOYSA-M
Melting Point 195-205 °C
Purity 95%+
Complexity 516
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 383.0924357
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 383.0924357
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the chemical formula of Chelerythrine chloride?

The chemical formula of Chelerythrine chloride is C21H18ClNO4.

What is the molecular weight of Chelerythrine chloride?

The molecular weight of Chelerythrine chloride is 383.82 g/mol.

At what temperature does Chelerythrine chloride melt?

Chelerythrine chloride melts at a temperature range of 195-205 °C.

What is the color of Chelerythrine chloride in its powder form?

Chelerythrine chloride in powder form is yellow to orange in color.

What is the solubility of Chelerythrine chloride in DMSO?

The solubility of Chelerythrine chloride in DMSO is ≥10 mg/mL.

What hazard codes are associated with Chelerythrine chloride?

The hazard codes associated with Chelerythrine chloride are Xn and Xi.

What is the primary usage of Chelerythrine chloride?

Chelerythrine chloride is primarily used as a cell permeable protein kinase C (PKC) inhibitor.

How does Chelerythrine chloride induce apoptosis in cancer cell lines?

Chelerythrine chloride induces apoptosis in cancer cell lines by inhibiting Bcl-xL function and activating p38 MAP kinase and JUNK signaling pathways.

What is the safety storage recommendation for Chelerythrine chloride?

Chelerythrine chloride should be stored in a freezer under -20°C in an inert atmosphere.

What are some of the references mentioned in the information about Chelerythrine chloride?

Some references mentioned include studies on its effects on protein kinase C inhibition, Bcl-xL function, and apoptotic DNA fragmentation and cell death in specific cell lines.

※ Please kindly note that our products are for research use only.