Chloroquine diphosphate

Catalog Number	ACM50635-2
CAS Number	50-63-5
Synonyms	Aralen phosphate
IUPAC Name	4-N-(7-Chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine;phosphoric acid
Molecular Weight	515.86
Molecular Formula	C18H32ClN3O8P2
Canonical SMILES	CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl.OP(=O)(O)O.OP(=O)(O)O
InChI	InChI=1S/C18H26ClN3.2H3O4P/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18;2*1-5(2,3)4/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21);2*(H3,1,2,3,4)
InChI Key	QKICWELGRMTQCR-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	359
Exact Mass	515.1353167
Heavy Atom Count	32
Monoisotopic Mass	515.1353167
Topological Polar Surface Area	184Ų

Custom Q&A

What is the chemical formula of Chloroquine diphosphate?

The chemical formula of Chloroquine diphosphate is C18H32ClN3O8P2.

What is the melting point of Chloroquine diphosphate?

The melting point of Chloroquine diphosphate is 200 °C.

How is Chloroquine diphosphate stored?

Chloroquine diphosphate should be protected from light during storage.

What is the color of Chloroquine diphosphate?

Chloroquine diphosphate is white in color.

What is the pH of Chloroquine diphosphate in water?

The pH of Chloroquine diphosphate in water is between 3.8 to 4.3.

What is the primary usage of Chloroquine diphosphate?

Chloroquine diphosphate is primarily used as an antimalarial drug.

What safety hazard codes are associated with Chloroquine diphosphate?

The hazard codes associated with Chloroquine diphosphate are Xn.

What type of activities does Chloroquine diphosphate inhibit?

Chloroquine diphosphate inhibits autophagy and has antimalarial, anti-inflammatory, anticancer, and antiviral activities.

How is Chloroquine diphosphate used in cellular processes?

Chloroquine diphosphate is used to study the role of endosomal acidification in cellular processes.

How is Chloroquine diphosphate synthesized in the manufacturing process?

Chloroquine diphosphate is synthesized by heating 4,7-dichloroquinoline with 1-diethylamino-4-aminopentane to produce the salt.

※ Please kindly note that our products are for research use only.