Cinchonidine sulphate

Catalog Number	ACM524618-1
CAS Number	524-61-8
Structure
Synonyms	Methanol sulfate dihydrate
Molecular Weight	686.9
InChI	InChI=1S/2C19H22N2O.H2O4S/c2*1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;1-5(2,3)4/h2*2-7,9,13-14,18-19,22H,1,8,10-12H2;(H2,1,2,3,4)/t2*13-,14-,18-,19+;/m0./s1
InChI Key	WBBHOISPYYYBTC-IDJJGHEZSA-N
Purity	98%+
Complexity	494
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	8
Exact Mass	686.31380637
Heavy Atom Count	49
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	4
Isomeric SMILES	C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=CC=NC4=CC=CC=C34)O.C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](C3=CC=NC4=CC=CC=C34)O.OS(=O)(=O)O
Monoisotopic Mass	686.31380637
PhysicalState	Solid
Rotatable Bond Count	6
Topological Polar Surface Area	156 Ų

Custom Q&A

What is the chemical formula of Cinchonidine sulphate?

The chemical formula of Cinchonidine sulphate is C38H46N4O6S.

What is the molecular weight of Cinchonidine sulphate?

The molecular weight of Cinchonidine sulphate is 686.86.

What is the boiling point of Cinchonidine sulphate?

The boiling point of Cinchonidine sulphate is 240 °C.

What is the density of Cinchonidine sulphate?

The density of Cinchonidine sulphate is 1.47 g/cm3.

What is the color of Cinchonidine sulphate?

The color of Cinchonidine sulphate is white to almost white.

What is the water solubility of Cinchonidine sulphate?

The water solubility of Cinchonidine sulphate is almost transparency.

What is the CAS number for Cinchonidine sulphate?

The CAS number for Cinchonidine sulphate is 524-61-8.

What are some of the product categories that Cinchonidine sulphate belongs to?

Cinchonidine sulphate belongs to product categories such as chiral, Alkaloids, Biochemistry, for Resolution of Acids, Optical Resolution, Quinoline Alkaloids, Quinolinecarboxylic Acids, etc., Quinolines, and Synthetic Organic Chemistry.

What is the RTECS number for Cinchonidine sulphate?

The RTECS number for Cinchonidine sulphate is GD3050000.

What is the HS Code for Cinchonidine sulphate?

The HS Code for Cinchonidine sulphate is 29339900.

※ Please kindly note that our products are for research use only.