Cinchonine sulphate

Catalog Number	ACM5949166-1
CAS Number	5949-16-6
Structure
Synonyms	(9s)-Cinchonan-9-osulfate(2:1)(salt)
Molecular Weight	686.9
InChI	InChI=1S/2C19H22N2O.H2O4S/c2*1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;1-5(2,3)4/h2*2-7,9,13-14,18-19,22H,1,8,10-12H2;(H2,1,2,3,4)/t2*13-,14-,18+,19-;/m0./s1
InChI Key	WBBHOISPYYYBTC-SJFRDBBCSA-N
Melting Point	206 °C
Purity	98%+
Complexity	494
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	8
Exact Mass	686.31380637
Heavy Atom Count	49
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	4
Isomeric SMILES	C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=CC=NC4=CC=CC=C34)O.OS(=O)(=O)O
Monoisotopic Mass	686.31380637
PhysicalState	Solid
Rotatable Bond Count	6
Topological Polar Surface Area	156 Ų

Custom Q&A

What is the chemical formula for Cinchonine sulfate?

The chemical formula for Cinchonine sulfate is C38H46N4O6S.

What is the CAS number for Cinchonine sulfate?

The CAS number for Cinchonine sulfate is 5949-16-6.

What are some synonyms for Cinchonine sulfate?

Some synonyms for Cinchonine sulfate include cinchonine sulphate, cinchonan-9-ol hemisulfate salt, and cinchona alkaloids.

What is the melting point of Cinchonine sulfate?

The melting point of Cinchonine sulfate is 206°C.

How is Cinchonine sulfate stored?

Cinchonine sulfate should be kept in a dark place, in an inert atmosphere, and at room temperature.

In what form does Cinchonine sulfate appear?

Cinchonine sulfate appears as white to off-white in color.

What are the safety hazards associated with Cinchonine sulfate?

Cinchonine sulfate is labeled with hazard codes Xi and risk statements 36/37/38.

What is the main usage of Cinchonine sulfate?

Cinchonine sulfate is used for its complete cardioinhibitory effect of vagus stimulation in dogs and as a Cinchona alkaloid.

How soluble is Cinchonine sulfate in ethanol?

Cinchonine sulfate is sparingly soluble in ethanol.

What is the packing group assigned to Cinchonine sulfate?

Cinchonine sulfate is assigned to packing group III.

※ Please kindly note that our products are for research use only.