Clathrodin

Catalog Number	ACM135383641
CAS Number	135383-64-1
Synonyms	1H-Pyrrole-2-carboxamide, N-[(2E)-3-(2-amino-1H-imidazol-4-yl)-2-propenyl]- (9CI)
Molecular Weight	231.25
InChI	InChI=1S/C11H13N5O/c12-11-15-7-8(16-11)3-1-6-14-10(17)9-4-2-5-13-9/h1-5,7,13H,6H2,(H,14,17)(H3,12,15,16)/b3-1+
InChI Key	PJKFCZYTTBYEHL-HNQUOIGGSA-N
Purity	90%+
Complexity	294
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	231.11201006
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	4
Isomeric SMILES	C1=CNC(=C1)C(=O)NC/C=C/C2=CN=C(N2)N
Monoisotopic Mass	231.11201006
Rotatable Bond Count	4
Topological Polar Surface Area	99.6 Ų

Custom Q&A

What is the chemical name for clathrodin?

The chemical name for clathrodin is 1H-Pyrrole-2-carboxamide, N-[(2E)-3-(2-amino-1H-imidazol-4-yl)-2-propenyl]-.

What is the CAS number for clathrodin?

The CAS number for clathrodin is 135383-64-1.

What is the molecular formula of clathrodin?

The molecular formula of clathrodin is C11H13N5O.

What is the molecular weight of clathrodin?

The molecular weight of clathrodin is 231.25 g/mol.

How is clathrodin used in synthesis?

Clathrodin is a natural modulator of voltage-gated sodium (NaV) channels.

What type of channels does clathrodin modulate?

Clathrodin modulates voltage-gated sodium (NaV) channels.

Is clathrodin a synthetic compound?

No, clathrodin is a natural compound.

What is the structure of clathrodin?

The structure of clathrodin includes a pyrrole ring and an imidazole ring.

How is clathrodin commonly used in scientific research?

Clathrodin is commonly used as a tool to study the mechanisms of voltage-gated sodium channels.

※ Please kindly note that our products are for research use only.