Clausine Z

Catalog Number	ACM866111140
CAS Number	866111-14-0
Synonyms	1,6-Dihydroxy-9H-carbazole-3-carboxaldehyde
Molecular Weight	227.21
InChI	InChI=1S/C13H9NO3/c15-6-7-3-10-9-5-8(16)1-2-11(9)14-13(10)12(17)4-7/h1-6,14,16-17H
InChI Key	FKDULSCBYNXNMP-UHFFFAOYSA-N
Purity	95%+
Complexity	309
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	227.058243149
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Monoisotopic Mass	227.058243149
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	73.3 Ų

Custom Q&A

What is the chemical name of Clausine Z?

Clausine Z; 1,6-Dihydroxy-9H-carbazole-3-carboxaldehyde; 9H-Carbazole-3-carboxaldehyde, 1,6-dihydroxy-

What is the CAS number for Clausine Z?

866111-14-0

What is the molecular formula of Clausine Z?

C13H9NO3

What is the molecular weight of Clausine Z?

227.22

What is the melting point of Clausine Z?

151 °C (decomp)

What is the predicted boiling point of Clausine Z?

565.1±45.0 °C

What is the predicted density of Clausine Z?

1.572±0.06 g/cm3

What is the predicted pka value of Clausine Z?

9.41±0.30

Are there any known synonyms for Clausine Z?

Yes, Clausine Z; 1,6-Dihydroxy-9H-carbazole-3-carboxaldehyde; 9H-Carbazole-3-carboxaldehyde, 1,6-dihydroxy-

※ Please kindly note that our products are for research use only.