Clauszoline M

Catalog Number	ACM187110721
CAS Number	187110-72-1
Structure
Synonyms	2,8-Dihydroxy-9H-carbazole-3-carboxaldehyde
Molecular Weight	227.21
InChI	InChI=1S/C13H9NO3/c15-6-7-4-9-8-2-1-3-11(16)13(8)14-10(9)5-12(7)17/h1-6,14,16-17H
InChI Key	IGPNSSMZXGKMGU-UHFFFAOYSA-N
Purity	95%+
Complexity	309
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	227.058243149
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Monoisotopic Mass	227.058243149
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	73.3 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 187110-72-1?

Clauszoline M

What are the synonyms for Clauszoline M?

2,8-Dihydroxy-9H-carbazole-3-carboxaldehyde; 9H-Carbazole-3-carboxaldehyde, 2,8-dihydroxy-

What is the molecular formula of Clauszoline M?

C13H9NO3

What is the molecular weight of Clauszoline M?

227.22

What is the predicted boiling point of Clauszoline M?

516.2±45.0 °C

What is the predicted density of Clauszoline M?

1.572±0.06 g/cm3

What is the predicted pka value of Clauszoline M?

8.15±0.30

How many oxygen atoms are present in the molecular formula of Clauszoline M?

3 oxygen atoms

※ Please kindly note that our products are for research use only.